ࡱ> ei  !"#$%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~Root Entry F jWfWorkbookETExtDataSummaryInformation(   \pPCdfda Ba==`w.8X@"1[SO1[SO1[SO1[SO1[SO1[SO1[SO1[SO1[SO1[SO1?[SO1,>[SO1>[SO1 [SO1>[SO1 [SO1[SO1[SO1Arial1 [SO1[SO1>[SO1h>[SO1 [SO1[SO1[SO1[SO15[SO1 Segoe UI15[SO1[SO1[SO1[SO+""#,##0;""\-#,##05""#,##0;[Red]""\-#,##07""#,##0.00;""\-#,##0.00A""#,##0.00;[Red]""\-#,##0.00i*2_ ""* #,##0_ ;_ ""* \-#,##0_ ;_ ""* "-"_ ;_ @_ W))_ * #,##0_ ;_ * \-#,##0_ ;_ * "-"_ ;_ @_ y,:_ ""* #,##0.00_ ;_ ""* \-#,##0.00_ ;_ ""* "-"??_ ;_ @_ g+1_ * #,##0.00_ ;_ * \-#,##0.00_ ;_ * "-"??_ ;_ @_ /\$#,##0_);\(\$#,##0\)9\$#,##0_);[Red]\(\$#,##0\);\$#,##0.00_);\(\$#,##0.00\)E \$#,##0.00_);[Red]\(\$#,##0.00\)@ @               @ @  *@ @ @ @    / ,@ @ )@ @ @ @ * @ @ - +@ @ @ @  @ @  @ @ @ @ @ @    @ @  @ @ @ @ @ @  @ @ @ @  @ @   @ @  @ @ @ @   @ @ @ @      ff7 @ @  @ @  `@ @ a@ 6 @ @ * @ @ + @ @  @ @ 6 @ @  @ @  @ @  @ @ / @ @  @ @ 6 @ @  @ @  @ @ 1 @ @  @ @ , @ @   @ @ @ @ / @ @ /   @ @ |@ @ |@ @ @ @  @ @  X@ @ |@ @ x@ @ x@ @  x@ @  x@ @  1|@ @   1|@ @   x@ @   x@ @   x@ @   x@ @  1|@ @  1|@ @   x@ @  1 |@ @ ||Z}-} }}}A}ef }}  ̙ ??v}}}}}A}L }A} }}}A}23 }-} }}}-} }-} }}}  }A}23 }-} }-}  }-}! }-}# }A}% }A}& }A}'23 }A}(? }A})23 }}* ??? ????????? ???}}+   }}}, ??? ????????? }A}-ef }A}. }A}/ }}U}0 }A}1 a}A}2 e}A}3ef }A}4 }A}5ef }A}6L }A}7ef }A}8L }A}9 }A}: }A};ef }A}<L }A}= }A}>L }A}?23 }A}@ }A}BL }A}C23 }-} }-}H }-}I }}M}}N}-}P }-}Q }}R}}S}-}T }-}U }}V}}W8^ĉ!20% - :_eW[r 32&20% - :_eW[r 3 eQeQ!40% - :_eW[r 32'40% - :_eW[r 3]]!60% - :_eW[r 32(60% - :_eW[r 3  8^ĉ 6 lʑ lʑ!60% - :_eW[r 22$60% - :_eW[r 2 h 4h 4 fJTe,g fJTe,g !hh"8^ĉ 12#ʑ'`e,g 5ʑ'`e,g $8^ĉ 8 %h 1h 1 &h 2h 2!'60% - :_eW[r 12 60% - :_eW[r 1 (h 3h 3!)60% - :_eW[r 42,60% - :_eW[r 4 *QQ +{{,hgUSCQ40% - :_eW[r 52/40% - :_eW[r 5!?60% - :_eW[r 52060% - :_eW[r 5@:_eW[r 6&1:_eW[r 6A8^ĉ 10!B40% - :_eW[r 62340% - :_eW[r 6!C60% - :_eW[r 62460% - :_eW[r 6 D8^ĉ 2E8^ĉ 13cc PK N@theme/PK N@ theme/theme/PKN@ky}theme/theme/themeManager.xml M @}w7c(EbˮCAǠҟ7՛K Y, e.|,H,lxɴIsQ}#Ր ֵ+!,^$j=GW)E+& 8PKN@theme/theme/theme1.xmlYo5G}k&]S-4YaV5sw>NM$$@{ABI㟡ch i_wssVEUsgk;CDHW=_}>qn<$4)ޥ߻UH"`},q J֗X anE`i(Ѝra{(>Q?G}FƣÀQiYhqU#T@5=`7}rGya`U[ڸEL-X[X5t]`8^6n8Jʰ=Er !.Wef~?xoRBpH3Q˄;ۛ&@Iw*uD*یBݶޕ XYl)֋p'.ߢUwWE|uyVJڦ6#XOM*M-avaP3gOĒu&l GT'зW=M$)@K8/Rͺ>!C;FNH3mhE8) )QMUP'V5pU&6r0y քA?V^ӿf P(sYHxHRi}T5NbeN }vQD~ϐJ0ArstK1%!N˭N,-\Vt+(wzULʟ*0XjpI,0ҙP!* hLh+^j-Ⱦ9giڣ# Bv,;X5ݻ,I2UW&V'k=Bj;{A@79|s*Y;̠[MC?1of]og{oQ=1kjYVVH E8Vk+֜L807D \$!?*|FL "B>g @dm0iRִi뤭mg|[Kvyssr,Zر[hjQv11?-`” hOPK N@_rels/PKN@֧6 _rels/.relsj0 }Q%v/C/}(h"O = C?hv=Ʌ%[xp{۵_Pѣ<1H0ORBdJE4b$q_6LR7`0̞O,En7Lib/SeеPK N@theme/theme/_rels/PKN@ ѐ'theme/theme/_rels/themeManager.xml.relsM 0wooӺ&݈Э5 6?$Q ,.aic21h:qm@RN;d`o7gK(M&$R(.1r'JЊT8V"AȻHu}|$b{P8g/]QAsم(#L[PKN@ $[Content_Types].xmlN0EH-J@%ǎǢ|ș$زULTB l,x\vTU^hd}㨫)*1P'^ח0)T9l#$> `?Cs]7zb$xu-lV{9>DVNj,5(Bȥszҕhhs0U~,}2ToF0,į*=댬o[gv; 9'33y ; oOPKN@ $ [Content_Types].xmlPK N@_rels/PKN@֧6  _rels/.relsPK N@theme/PK N@ $theme/theme/PK N@theme/theme/_rels/PKN@ ѐ' theme/theme/_rels/themeManager.xml.relsPKN@ theme/theme/theme1.xmlPKN@ky} Ntheme/theme/themeManager.xmlPK ? XTableStyleMedium2PivotStyleLight16`aSheet1Sheet2Sheet3VV4T "qC A@!  ;!  =!  = *^SoTT Th:yuNON TyoTĉ\^ߘToTh@b2 NS-NoNN gPlQS0.2g20180301`]'YN~n^yXo?b_lbR^ `]^ߘToTh@b3?e@S gm_lwɄXoNN gPlQSk/eň20kGS 181001 101^NNmTXoNޏ gPlQSz_^t^R^$ 0-NVoxQ 02015t^HrNSV[oTvcw{t@\lQJT2018t^,{19Se [Oq\^z_:SoTh@b4?aSl|Gr b3;SoOeP gPlQS50mgBJ41394[Oq\~vYXoNޏ gPlQSO)R-NGlR^5 mg]-NNSN6Ro gPlQS1811116 T'YSgޏo^ gPlQSO[lt_lN~nR^% 0-NVoxQ 02015t^HrNSeEQ3uybNybNS2017B00041  T^ߘToTh@b6?gRceGrwoƖV-NoNw[^ gPlQS c[C16H19N3O5S]{0.25g 160180809 wm0NSN`'Yo^ gPlQS.V[ߘToTvcw{t@\V[oThQYBH009220110 0-NVoxQ 02010t^Hr,{NXe,g7?gr^m`BR [Oq\Kb_6Ro gPlQS0.25g ( cC16H19N3O5S)1902572 [Oq\^ߘToThhKm-N_80.125g( cC16H19N3O5S)18123669?gV SN`^Q`6Ro gPlQS0.25g02180204 cSlFZ^_;So^c3^oTh@b1002280216^loNޏ gPlQSowmRlQShG m^ ^NwUl4Y^oTh@b11[Oq\Kb_6Ro gPlQS(S?yr~e[Oq\ 6Ro gPlQS)190255212VoƖVUl4Yёw6Ro gPlQS180622 no]^Xneh:SkSub 0-NVoxQ 02015t^HrN,{568u no]^ߘToTh@b13 wmWSwmR6Ro gPlQS  cC16H19N3O5S{0.25g    180710^N1r_'Yo?bޏ gPlQST3R^ sQ^ߘToTh@b14 wmm(yv\)oN gPlQS180112 Ul4Y^noWS:SSVfo^15 VnS/Uh6Ro gPlQS20171201 Ul4Y^~vsO Ob;So gPlQS16 VnWS-NT6Ro gPlQS  cC16 H19 N3 O5 S0.25g    180503 _^Sg3oTFU:W^^oTh@b17  Tgw)RNS6Ro gPlQS cC16H19N3O5S 0.25g20181109[n_l'YSgޏo^ gPlQS/ceR^ [n_l^ߘToTh@b18 TgNoNƖVhloNN gPlQS20180701ZSWSNSG8l^Xo^,{NR^19ePlƖVS_lVo] gPlQS180727 no]^)Yڋ;So gPlQS20 q\ ToN gPlQS 180910 NO.110 cSlFZO o^21 m3WؚSSoN gPlQS180905vs^SVo;So gPlQSXnehWe'Yo?b22 0.25g( cC16 H19 N3 O5 S       171018 XXSG>y:SE\YO,{ NkSuz 3_l^hKmh-N_23 cC[16]H[19]N[3]O[5]S 0.25g 325180506m3W^s^[yoNޏ gPlQSSy^ m3W^oThxvzb24 V]Oy6Ro gPlQS0.125g180920 ln^Ts^SXG`To^ln^oTh@b25 o6RoƖVN gPlQS18100526swmT6RoN gPlQS-Nq\RlQS90100209no]^eCSyoN gPlQSVo'Yo?b2781200204V[ߘToTvcw{t;`@\hQYBH0532201828?g| [_Nm0NoN gPlQS18040829wmWSwё\6RoS  cC16 H19 N3 O5 S0.125g    20180503 `ƖSNTn;So gPlQS30 0.125g cC16H19N3O5S     181104 NO.046YtQS\G]NX'Yo?b\^31 ?gKQb~xGr. 0.457gC16 H19 N3 O5 S 0.4gNC8 H9 NO5 0.057g       "$ &90305508 -Nq\^ߘToTh@b32/ 0.375gC16 H19 N3 O5 S 0.25gNC8 H9 NO5 0.125g      ! #% '9020240633?GY }RceGr VoNN gPlQS20180602 ޏ]^NTX'Yo?b 0-NVoxQ 02010t^HrN n܏^ߘToTh@b34?S9SgnGr SN-NeoNN gPlQS25mg180301 ln^Ts^S3fG`lo?b35 VnWSeGl6RoN gPlQS180907`]^ePl;Soޏ gPlQSZSW[ޏ^36190102 Ul4Y^8lRoT gPlQS37 etQSNbG`^'Yo?b 0-NVoxQ 02015t^HrN,{546u Nnm^ߘToTh@b38l^ySN uir6RoN gPlQS181201 WSSWGWSo^39180101^NeP;Soޏ gPlQSVO^^40?fm\Gr _lςĞloNN gPlQS1808026_l'YSgo^ gPlQSnoޏR^_l^oTh@b41?fmRceGr VnSVs6Ro gPlQS0.1g171109 ln^+}ёSIN[GtQoLV[@\hQWS1-(X-054)-2003Z42?fmGr  Nwm NoO oS gPlQS04181101vs^SVo;So gPlQSXneh8lb'Yo?b 0-NVoxQ 02015t^HrN,{551u43 m3WwmsoN gPlQS20180907ln^U\tQoN gPlQSU\o^ 0-NVoxQ 02015t^Hr,{N4420171101ޏ]^SVn;Soޏ gPlQSWSR^45~SUNGr q\NO 6Ro gPlQS1mg ^]^/T~_zf;Sb gPlQS^]^oTh@b461r[s^(vx.lSSe@l;UBR)MEDA Manufacturing GmbH10ml: 10mg 60U kU0.14mg^];So gPlQSۏSoTlQhQJX2017001247[dW| [ꁛR-NoƖV gPlQSkň10g201812093%f^ N}Y'Yo?bkSuoThQ-Nobe6RBR,{AS]NQ48[~uGr m3 OoN gPlQSW[^'Y fo^ 0kSuoThQ 0-Nobe6RBR,{NQ,{62u49[CNяGr ܏'Y;So-NV gPlQS0.5g181012 etQSmQVyG[[Xo^ 0-NVoxQ 02010t^Hr,{NXe,g,{362u50[CNяl\m ^NWSVoN gPlQS2ml:0.5g1808081 dq\^SGkSub 0-NVoxQ 02005t^HrXe,g512ml0.5g180809152[^ye_8Nu)Y4l\ĞoN gP#NlQSk158N͑2KQ180214e0NSz^o^ 0-NVoxQ 02015t^HrN53[΀8N ^N"%f6Ro gPlQSk8N͑6g190202V[oThQWS3-B-0074-89-154(l6xGr100mg180601^N~vOޏ;SoirAm gPlQSno]R^ 0-NVoxQ 02015t^HrN,{1153u55 q\*YSoN gPlQS181034 etQSzQgG:Nlo^56q\*YSoN gPlQSS*YS6RoS 18102757181024n܏~vY'Yo?b;Soޏ gPlQSo4lX:_NW^58181101 Ul4Y^lb^;So gPlQS59181210 Ul4Y^^tloN gPlQS60(l6xl\m lWSm_6RoN gPlQS!  cC2H8N2(C7H8N4O2)22H2O2ml0.25g         1812083 nS]WNG-N_kSub61(lZpOeV 'Y T^)RoN gP#NlQS/ 18040400163ؚe:SNT'Yo?b" 0V[oTvcw{t@\V[oThQ 0Sf[oT0WehQ NGSV[hQ,{ASQ62(lTĞOeVYYoN gPlQS Ye1811091 YtQSW]WGN1rs^N'Yo?b-V[ߘToTvcw{t@\V[oThQWS-10001-(HD-0276)-2002-200663^Nw1r_'Yo?bޏ gPlQSYtQ\R^64^NNRƖV6RoN gPlQS5180406`]^~vY;So gPlQSNz`TEu^65 _l^_lwm:SleP'Yo?b665180303 -Nq\^N:S~vy^o?b"V[oThQWS-10001-(HD-0276)-2002-200667^]}vNq\IQNS6RoN gPlQST80032 i`s^^TXG~vnVoFU^68T80051-V[ߘToTvcw{t@\V[oThQWS-10001-HD-0276 -2002-200669T80095^NeP;Soޏ gPlQS`Ɩ~eN^70 lSNnfoN gPlQS180305ޏ]^^)Ro?b71  Tgw^yoN gPlQS20181001< _lwm^pʋ@b72`]^ePl;Soޏ gPlQSO:Wޏ^73*k|+T[YNp(lWZ0.25KQ0TaUV15kKQ0legx/lOe1kKQ0N][rĞ10kKQ180702 WSĖ^Ė]WSPN^o^741808043 -Nq\^ NaNGlePoT.U^75 Ym_l^i`6RoN gPlQS180518n܏~vY'Yo?b;Soޏ gPlQS_Ğ^:W^76 (lOeV(a!) m3W^-NT6Ro gPlQS1810553 0V[oThQ 0eolckhQ,{75Q77(l|nGr ^N86RoN gPlQSkGr+T2TT25mgTvx(lWa|75mg20180801 3q\S*Ys^G}vx^yo^!V[ߘToTvcw{t;`@\V[oThQWS1-XG-043-201678eY.ls^Gr _lςjhoNƖV gPlQS5mg181205m3W^Nl;SbV[ߘToTvcw{t;`@\hQYBH0547201879eYbUnV20mg190149580 ^NNRW[6Ro gPlQS 0-NVoxQ 02015t^HrN,{1413u81wmWSkZoNƖVN gPlQS180908 Ul4Y^-N^t;So gPlQS82 -Nq\^TёoT.U gPlQS83 `^oNƖV gPlQS14380943^^Vn:SG܀uXo^84 Ym_lN*YoNN gPlQS8171212 Sq\^vlQgG-N_kSub( 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t;`@\hQYBH0201201585kQsTBhV NWS8l\[X6Ro gPlQSk|ň0.4g20180203 [Oq\^WSwm:S~^Xo^-V[ߘToTvcw{t@\V[oThQWS-10239(ZD-0239)-2002-2011Z86 ]b)Yv]b)Y ^]O-NonGr gPlQS -Nq\'Yf[D^\,{mQ;Sb87}vdž I^NT0N-NonGr gPlQSN0W_l -NoPgnGr 180901m3W^-N/n'Yo?b gPlQS {\R^ 0^Nw-NonGrp6Rĉ 0,{NQ88 ^Nes6Ro gPlQS180501[n_l^~*Y3oNޏ gPlQShU_>ee0^89~vTVёGr ^]ё6Ro gPlQSkGr͑0.4KQ1 0-NVoxQ 02015t^HrN萌TV[ߘToTvcw{t@\V[oThQYBZ08222005-2009Z90~vӅYTXpGr UNl6Ro gPlQSGr͑0.3KQ 8F0101849^NsQ1r'Yo?bޏ gPlQS^[SWSWGe[WS~vY'Yo?b#V[ߘToTvcw{t;`@\V[oThQWS3-BW-0124-98-1391gP[{Q_8N ff-NoS gPlQS280484  T^W:SNmlo^92*YgƖV͑^PhToS gPlQS18090010 z]:SNSl;SoFU:W93b YPN(vxlf/lSl\m)Bayer AG250ml:lf0.4gN/lS2.0gBXJ6TT3b3;SoOeP gPlQS^]RlQSۏSoTlQhQJX2012021194g݄9h| ^NR`ڋ6Ro gPlQSkň10KQvS_NnGr14KQ 190320195 ^N^GYRoNN gPlQSkň10KQ1810004ln'YSgo^ gPlQS0NnR^96180204 3%f^%fWWo^97 ^Nln6Ro gPlQSkň5gvS_NnGr7g TA00298 ^NNyoN gPlQS181210899190204 0-NVoxQ 02015t^HrN,{1033u100 ^yeoNN gPlQSkň5KQ(vS_NnGr7KQ)180906 [n_l^aW4Y:SeP^o^101^]}vNq\TĞW-No gPlQSkň5KQJ18A014no]^'YSgo^ gPlQS T)RR^102^]^6RoN gPlQSYXb^NS]-NoS6Ro gPlQSkň10KQ(vS_NnGr14KQ) 201811106Ul4Yؚe:SNS)YoNޏ gPlQS_lR^103 Tgw~vt^mQyXoN gPlQS20180314104 _lܔNT6Ro gPlQS180405Ul4Y^_l'Y;So gPlQSlTR^105 _lojh6Ro gPlQS180103106 Nges;SoƖV gPlQS 201812001107 SNoNN gPlQS041709135u}v:SdWCQo^108 -Nq\^R`uoN gPlQSk|ň10gvS_NnGr14g 20190303109g݄9hGr ^Nj_oN gPlQS kWGr͑0.25KQ180401 ln^NnS݄SG݄NSo^$ 0kSuoThQ 0-Nobe6RBR,{ NQSV[@\oThybQN2008011110ހxƀxl\m  NMbw\6RoN gPlQS 2ml0.25g20190201111O?Q[| 0kSuoThQ 0-Nobe6RBR,{ASVQ,{124u112OT8N q\eoNƖV gPlQSk8N͑9KQ20180303 T^N^goNޏ gPlQSΏ[R^113O΀upGrYm_l^_oNƖVN gPlQS cGrkGr͑0.39g18101681 m3W^^eP;So gPlQSV[ߘToTvcw{t@\hQYBZ00692008114SF9hV  Y^oNƖV gPlQS30mg820063 3q\S\gekGvuo?b115xx(l/l0Ws^Gr VnS\ooN gPlQS^NeP;Sbޏ gPlQS`Ɩ~kS^116 NSm[yoN gP#NlQS1812001`]^~vY'Yo?b;Soޏ gPlQS0W^V[oTvcw{t@\hQYBH05922018117 _l6Ro gP#NlQS18101321181807251 Ul4Y^noWS:S\q\NĖo^119Y񂠔Gr )Y%mRu6RoN gPlQS1708015Nnm^Nl;Sb 0-NVoxQ 02015t^HrN,{615u120nlGr 8^]^nfoN gPlQS1810013Ul4Y^no3:SeIQWS[[o^121;Gr ^]}vNq\-NNoN gPlQSkGr͑0.27KQX00005 _l^eO:SOWTNm'Yo?b! V[ߘToTvcw{t;`@\V[oThQWS3-B-1454-93-4 122;p^GrVoƖV_O([Oq\)oN gPlQSkGr͑0.37g+Tlegx/lOe1mg 18366123;p[| ^l0NoN gP#NlQSkň15g180701-Nq\^\iGWSSS8oPgFU^kSuoThQ-Nobe6RBR,{ASQ124!TbfWGr ^NNSWSoNƖV gPlQS0.4g181002^NeP;Soޏ gPlQS3SXXSR^125!TUpGr b&NSoN gP#NlQS m3W^ba'`u2l-N_126 yrNoNƖVN gPlQS11181102ln^NnSvl'Yo?b݄SR^127hpnV m3W^l^6Ro gPlQSk|ň0.5g^NNml;Soޏ gPlQS44R^V[ߘToTvcw{t@\hQYBZ05742008128 iiVm8N4l8N u[ON6Royb gPlQS180502 -Nq\^ N҉GUlo^129NlZsNrl\m ^N VZS6Ro gPlQS 10ml:100mg5A181114V[ߘToTvcw{t;`@\hQYBH01522017130 50ml:500mg 2A181208-2131 20ml:200mg5A181105132 NlZ-N/sNl\m5C181203V[ߘToTvcw{t;`@\hQYBH03982014133Nkx'l'VvUGr170801134 |NS6RoƖVN gPlQS31180404ln^~vOggoNޏ gPlQS^:WRlQS135N bxGr VnWSwXn-N6Ro gPlQS181108136180914 ^^z]:SR`v'Yo?b137 esOPN( bx̖NGr)Delpharm Lille S.A.S461AۏSoTlQhQJX20100066138e:_Vk|ň0.3KQ ^^Vn:SGleo?b!V[ߘToTvcw{t;`@\V[oThQWS3-B-0751-91-5139e:_Gr m3)YuoN gP#NlQSkGr͑0.25KQ181001O[^hf-No^, 0kSuoThQ 0-Nobe6RBR,{ASNQSV[@\oTeEQhelTyvybQN2009030140 e-Nvl8NSm)8N Vn _R`%foN gPlQS k88NvS_NSuo3KQ1810061Hm_l:SePo^ 0kSuoThQ 0-Nobe6RBR,{NQWS3-B-1347-93141^mʑV y^*Ys^ m6Ro gPlQS0.3g180514`]^Nz`ؚe:S|oO'YeNo^1420.3KQ20181202 0-NVoxQ 02015t^HrN,{178u1438030200414490302001145 swmm6RoN gPlQS 3091811033^NeP;Soޏ gPlQS`Ɩ~kS^146^mm`m  Nwm:_u6Ro gPlQS100ml2g 181207181VocV'Yo?bm3W ޏ gPlQSdžSeWR^-V[ߘToTvcw{t;`@\V[oThQWS-341X-311 -20011 -2014Z147 181205178 m3W^WVn:SY|^OePb148^m| VnS~vyNoN gPlQS0.2KQ180403 `ƖS`WGeyTo?bV[ߘToTvcw{t@\hQYBH09452009149^mGr lWS-NpgoN gPlQS1704202 0-NVoxQ 02015t^HrN,{177u15032181001 NGW'YaWq\,{AS NkSuz151< yrNoNƖVN gPlQSS^NSW6RoN gPlQS 11180910 WNGq\QgYOUYCgkSu[152)YeoN gPlQS 171109082153Sς8NQS)YGY-N6RoN gPlQS12160718m3W^z0N'Yo?b gPlQSYR^154 q\NS^oNN gPlQSkň6g20180401^NsQ1r'Yo?bޏ gPlQS_[:_^155υRgUGr ^#WyroN gPlQSkGr͑0.5KQbN(ukGr+Tr^xm40kKQ 181103 _^Sg3oTFU:W[)W^ 0kSuoThQ 0-Nobe6RBR,{kQQ1566xʑGr ^]ȏyrtQNS6RoS gPlQS 0.1g cvC7 H8 N4 O2      20180702 -Nq\^l;So gPlQS157g^^Vn:S)YKNeP-NonGr gPlQSN0WlS TZJ190102 T'YSgޏo^ gPlQSS]RlQS158gĞ| V]~v)RoN gP#NlQSkň3KQ171206 WSĖ^Ė]WS^o^V[ߘToTvcw{t@\hQYBZ00032008159I Ul4Y^|NoN gPlQS160^Gr VnWSXnloNN gPlQS kGr+Tvx\jx50mg _^S_WV%fXo^161p[Vk|ň0.3g180605ln^ޏs^SWGNTXo^V[@\oThQYBZ07212005-2015Z-2162fMRP[nGr ^]^)Yl[mX-NonGrS163H2}v2Gr ^*toNƖV gPlQSkGr͑0.3KQ (+T!k]xx˔ 0.066KQ)180815 WSoST[GeP^o^164 ^*toN gPlQSkGr͑0.3KQ+T!k]xx˔ 0.066KQ 181114 O[^NGȇo^e\R^165 ^ga[n;Soyb gPlQSkGr͑0.3g+T!k]xx˔0.066g 180703[OQ_'Yo?b( 0kSuoThQ 0-Nobe6RBR,{kQQSV[oxQYXTOoxQNS020020417S166umpup| lWSNX6Ro gPlQS kň10KQ(e|))YXR'Yo?bޏ^N gPlQS,{kQRlQS167dw190101168]n|Fm190201 0kSuoThQ 0-Nobe6RBR,{NQ,{14u169]6| kň4ge| 18003170zq\2upq\2u _lm_lVoXnGr gPlQS16103112 ZSWSehNfoTFU:W171zsmpV0.25KQ/|"V[ߘToTvcw{t@\V[oThQYBZ29912005-2012Z172zsmpGrkGr͑0.23KQ190104CV[ߘToTvcw{t@\V[oThQWS-10487ZD-0487 -2002-2012ZSV[@\oTeEQ3uybN2015B01586173z_V _lR`^oN gPlQSk|+Tz_r^xm0.105g20181101 -Nq\^\iGH܀No^174z_QooV ё?oNN gPlQS k|+Tz_Qo50kKQ181008^NeP;Sbޏ gPlQSVn4lQWN^"V[ߘToTvcw{t@\V[oThQYBZ07132005-2009Z175z_GrI18A003^Nё^o?bޏ gPlQSn܏R^176^\RKNnoN gP#NlQS20170301m3W^-NT'Yo?b gPlQS-NT'Yo?bQWN[R^177UGr q\N~v~oN gPlQS kGr+TvxKQNyrW10g20171209^NetQoT gPlQSoeh'Yo?b)  0kSuoThQ 0-Nobe6RBR,{ NQWS3-B-0636-91SoxQNS,{364S 178Ha*V _lZSXoN gP#NlQSk|ň0.26g20180101[Oq\^WSwm:SĞ;SX;Su gPlQSlm~TʋV[ߘToTvcw{t@\hQYBZ10822008179:RNRGrў_l~FIgoN gP#NlQS |cGrGr͑0.25KQ 181204O[^ޘ'Yo?b180x0W^Xs|~gGr BboNN gPlQS0.75mg170816 etQSf\Ghgo?b 0-NVoxQ 02015t^HrN,{1531u181BboNN gPlQSS)Y%moNƖVeѐN gPlQS 171017 ^N[oN gPlQS182 Ym_lNt6RoN gPlQS170738[Oq\^-N)YoNޏ gPlQS4Io?b183170247^loNޏ gPlQSwVR^184170248Ul4Y^_l'Y;So gPlQSVnR^185xl<\~gGr [_ё*Y3uSoN gPlQS5kKQ1808022ln^]SoTlQS'Yo?b186 [3^NS[oN gP#NlQS181111  T^5u}v:Sm^'Yo?b187 ~vckoNN gPlQS1805004Vo_l;Sb1881901517189  Nwmё NbcpQ6Ro gPlQS20170504 Ul4Y^owm:SNS[o^190'YĞxx"lGr ^ASNq\6Ro gPlQS1808501 0kSuoThQ 0Sf[oTS6RBR,{NQ191'Y;m~Vk|ň0.25g181004m3W^WSSoLޏ gPlQSWSSoL\R^ 0V[oThQ 0eolckhQ,{52Q192'Yq\Bi8N111806133%f^[lXo?b1939NNGrSN TNXybSU\N gPlQS6RoS  }GrkGr͑0.3g18120021SN TNX[Oq\ޏo^ gP#NlQSsQR^194ƀWSf Q_looN gPlQS ^NNGr)Y;SoƖV gPlQS5 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t@\oTheEQhelThyvybQNS2007010195Q_looN gPlQSN0WV] 161201^N%f)YN~vޏo^ gPlQSS]'YK\^:W^196 V]~v܀oN gPlQS160805e0NS^uXo?b+ 0-NVoxQ 02015t^HrNSV[@\oTheEQhelThyvybQN2007010197S_R_198S_R_GrkGr͑0.3g180602 0kSuoThQ 0-Nobe6RBR,{NASQ199kGr͑0.3KQ ln^Ts^SXG_zfo^200 O[^OW'Y T)R;SoFU:W201S_R_{Q@8NSK006202ZQSnGr ^]^ V-NonGr gPlQS^]N)YX'Yo?bޏ gPlQS203opSS| NWS iiroN gPlQS20160902204 SU-(vxN2uS̀Gr)Alphapharm Pty Limited^NwW'YeP^oN gPlQS5ۏSoTlQhQJX20030010SV[ߘToTvcw{t;`@\oTlQybN(ybNS:2014S00641)205 0W^Xs|~gxxl\m^]}vNq\)Y_6RoN gPlQS1ml5mg181214eO fOlʋ@b206 VoƖV[u6Ro gPlQS1ml:5mg181020620720181102 nS_l>\GkSub208201902532091ml2mg20190154210)Y%mёƖVVnS)YooNN gPlQS1ml:2mg51804211211QQIGrGr_͑0.25KQ^NNOoN gPlQSz_{Q!`io^212  N\^[uir6Ro gPlQSkGr͑0.26KQ180504213\gNs^SGrkGr͑0.36g20171001!V[ߘToTvcw{t;`@\V[oThQWS3-B-2143-96-3214 [YNp(lWZS gnm2.4% 0V[oThQ 0Sf[oT0WehQ NGSV[hQ,{VQ215[YNp(lWZGr V]wegXoN gPlQSޏ]^^[o?b21611181008O[^'YbG~vTXo^sVn^217 )Y%m^ePu6Ro gPlQS181206^'YSgo^ gPlQSؚWS\R^218YvGrv0.3KQ Àˆ}vv13kKQ 3_l^~v^oN gPlQS萁hQN,{mQQuSoT,{NRQ 219YXoznGr10mg1901455 0-NVoxQ 02015t^Hr,{NXe,g220 =NsƖV=Ns6RoS10kKQ221?Qzy3t(?Qz Ye(lZ }Gr)x^y;So gPlQS1kGr+T[YNp(lWZ125mg,vxS'l Nz }2.5mg,legx/lOe1mg,~u }B1 1mg9CV1ۏSoTlQhQJX20090009222NN|  Tg+}kyboN gPlQSkň20g1804012 W[^eP:_;So gPlQS 0-NVoxQ 02015t^HrN,{435u223 N2uS̀\^~g;Soޏ gPlQSF0N,{NR^442h]^t0N;So gPlQS0NVn^t0N'Yo?b h]^ߘToTvcwh@b443:Rs^Gr181106444K{8NGr180311`]^)Y[XoNޏ gPlQSlWNR^ 0kSuoThQ 0-Nobe6RBR,{AS NQ445NGr |cGrGr_͑0.32g TA007446tP[  T^eP6Ro gPlQS447sQbku VnWSё[6Ro gPlQS181003448^ _lzyX-NonGr gPlQS0.5kg/^N%f)YN~vޏo^ gPlQSehWS^4492u{Q4Gr170901450BhD0WĞ8N'Y8Nk8N͑9KQ?̑eP^'Yo?b;Soޏ gPlQS451Bh)RUGr 0-NVoxQ 02015t^HrN,{1116u452453454 =NsƖV)Rl6RoS45520180103456Ǐ'lS"lnm3%190111457}YSe(Qa)( Yeq\ёf4Gr),Teikoku Seiyaku Co.,Ltd. Sanbonmatsu Factory 1014cm2/4ۏSoTlQhQJX20140344458}YSe()na)( Yei4Gr)ۏSoTlQhQJX20140343459 ўΘ;m~VVoƖV TNmX5] 6Ro gPlQS180604-V[ߘToTvcw{t@\V[oThQWS-10232ZD-0232 -2002-2011Z460ўzGrV]_llk4NDP[oN gPlQS N0WV]180303^N1r_'Yo?bޏ gPlQSe0NNlR^461~ eGr  Tg T%f6RoN gPlQSkGr͑0.4g170501V[ߘToTvcw{t@\hQYBZ10272009462~ёm~Gr cGrkGr͑0.42g20170901^NVo;SoޏON gPlQSm3WeNOR^V[ߘTovcw{t@\oThQYBZ08332008463~ }nGr0.125g12.5NUSMO 11181003464~ }o1%1709241 sNnvteꁻlS_̀GkSub465UuupGr -Nq\^SGGfek~vu'YoLkSuoThQ-Nobe6RBR,{VQ4664s4ỸGr y^w Nf)Yl6Ro gPlQS20180404 0kSuoThQ 0-Nobe6RBR,{ASNQ467 kGrvS_N4s4ỸNSO1KQ468 kGrvS_N4s4ỸNSO1g 3q\S_lO^o^469D1711058 0kSuoThQ 0-Nobe6RBR,{ASNQSq\wߘToTvcw{t@\oTQlQybNybNS2015R005569 470%tYN~ }| [)RT6Ro gP#NlQS  cC37 H67 NO13 { 100mg10NUSMO     1804034010471bGr |cGrGr_͑0.35g m3W^CQTXoNޏ gPlQSVnR^472kGr͑0.35g 0-NVoxQ 02015t^HrN,YBZ04232008473 ў_luoNN gPlQS 201803111474170702475~Gr^Xeꁻl:S~oNN gPlQS cGrkGr͑0.29KQ_l'YSgo^ gPlQS_loSNR^476Sus^UGr SuoNN gPlQS 170908 121477180711 `ƖS`WGeP'Yo?b478 ޏq\XevteꁻlS)ROo^479180407480 %fe[oN gPlQS20161104481i҉8NTB001482sb[ }oV  0V[ߘToTvcw{t@\V[oThQ 0eolckhQo,{NASNQ483484ĞgV k|vS_NSoPg1g485180806486Ğޏ NnGr [_]Ne6Ro gPlQST 0-NVoxQ 02015t^HrN0V[ߘToTvcw{t@\oTheEQhelThyvybQN2009018S[_wߘToTvcw{t@\oTQlQybN2015R001258 487 _s^^ NW:So^1 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t@\oTheEQhelTyvybQN2009018488n܏'YSgޏo^ gPlQS3q\_lR^X 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t@\oTheEQhelThyvybQN20090180[_< wߘToTvcw{t@\oTQlQybNybNS2015R000263 489+ 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t;`@\oTeEQhybQN2009018490 y^PN\^oN gPlQS |cGrGr_͑0.3g 1806123 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t@\oTheEQhelThyvybQN20090184910.30g/Gr180312_s^^ NW:Seo^_NSR^492n܏^ne:S*YTGR`u'Yo?b493180409m3W^u;SbR 0-NVoxQ 02015t^HrN0y^wߘToTvcw{t@\oTQlQybN2015R0001100V[ߘToTvcw{t@\oTheEQhelThyvybQN20090184941807074950.30g180916ؚe:S~vYo?b496 NS3i`e oN gPlQS ln^nW:S)Rs^'Yo?b" 0-NVoxQ 02015t^HrNSV[@\oTheEQybQN2009018497180507498 Nwmwmy[NƖV ]VnNoN gPlQS_l'YSgo^ gPlQSdq\e)Y0WR^499181130n܏'YSgޏo^ gPlQSޏ]Sq\R^500  O%fNRSoN gP#NlQS |cGrGr_͑0.24KQ 20180604 _s^^s^^oT gPlQS501502ĞGr ^#Wl6Ro gPlQSln^NnSVnGVnQgkSuz503kSuoThQ-Nobe6RBR,{NQ504xGr11181201I\NmlX;So gPlQSN~RlQS 0-NNSNlqQTVkSuoThQ 0Sf[oTS6RBR,{NQ5054 NkxGr bV VTT6Ro gPlQS180404`]^~vY'Yo?b;Soޏ gPlQStQ^ 0V[oThQ 0Sf[oT0WehQ NGSV[hQ,{kQQ506;m~muGruoNƖV(sO(ge) gPlQS 201801006507ƀ8N508cklTBRwoƖV_lёɄoNN gPlQS180114 -Nq\^lvX'Yo?bkSuoThQ-Nobe6RBR,{NQWS3-B-1466-93509cklV _le܏ePoN gPlQS180615`]^^_'Yo?bޏ gPlQS?`ޏ^!V[ߘToTvcw{t;`@\V[oThQWS3-B-2266-96-1510180207^Nz^X'Yo?bޏ gPlQSJS\1SR^!V[oTvcw{t@\V[oThQWS3-B-2266-96-2002511ZFB1709#V[ߘToTvcw{t@\V[oThQWS3-B-2266-96-2002512cklS gm*YgƖV͑^mu6RoS gPlQSk/eň10kGS513ckl4l514190309 0-NVoxQ 02015t^HrN,{1728u515 V]i_y6Ro gPlQSktň10kGS516ckl8N lq\)Yy^oN gPlQS20180416 0kSuoThQ 0-Nobe6RBR,{NQ517 ckl8NSm)8N k88NvS_NSuo3g20180304518Gr ^N|_oN gPlQS 0-NVoxQ 02015t^HrN,{379u519 ln^]S0NzGkSub52020180904  T^|;So gPlQS521 ^NR`^6Ro gPlQS522 ln^ޏs^S~2m'Yo?b5231180016`]^oeP;So gPlQS+}ёS,{NAS NR^52411800055251180006526l\m 2ml:100mg1901142527!@528RsTckl8N  T^5u}v:SvlX'Yo?b 0kSuoThQ 0-Nobe6RBR,{ASVQ529530lnR`uoN gPlQSXXo^5312uxV[)RT|NSoN gP#NlQS20170501YO(W;Sʋ@b5322uRceGr _lςVsuir6Ro gPlQS0.5mg1805261V[ߘToTvcw{t@\hQYBH051420085332uNup| q\NnXoN gPlQS20181205 `NS^ՈX'Yo?b"V[ߘToTvcw{t@\V[oThQYBZ12242006-2010Z5342u]xUGr -Nq\kpp_S:SNXo?b535180637 0-NVoxQ 02015t^HrN,{213u536180909O[SR;Sb537180308 -Nq\^gGz[o?b5382u'l/lnfGr _\6RoƖV gPlQS18010104539kGr5mg20181203540ePÀmߘGrkGr͑0.5KQ 0-NVoxQ 02015t^HrN,{1366u541 _l-NoNN gPlQS kGr͑0.5gcGr 18101014)V[ߘToTvcw{t@\hQYBZ00402011N&{T 0-NVoxQ 02015t^HrBl54218060024m3W^s^[yoNޏ gPlQS^:W^' 0-NVoxQ 02015t^HrN0V[ߘToTvcw{t@\hQYBZ00402011543eP3V 5]ePtQoN gPlQSk|ň0.4KQ20180201Voc^] gPlQS^'Yo^'V[ߘToTvcw{t@\V[oThQWS3-276(Z-036)-2003(Z)544P lSZiΘ-NonGr gPlQSB604061 T^FupbD gPlQS^No?befRlQS545SOg˔V  NwmꏉQW6Ro gPlQS50kKQؚe:S)Y:_'Yo?b546~wGr^h]6Ro(ƖV)N gPlQSkGr͑0.3gvS_NSoPg2g ^N)Y_X;So gPlQS[Oq\ N4lNSR^V[oTvcw{t@\hQYBZ00572003547ёIbku| ͑^ ^\[oN gPlQSkň8g180509&V[ߘToTvcw{t@\V[oThQWS-5681B-0681 -2012Z548ёgnTUGr ^eeuoNƖV gPlQS1707008 ^ؚe:SONmJW'Yo?b549ёMRaQV O[)Yim6Ro gPlQS^NsQ1r'Yo?bޏ gPlQS^[SWSWGesWN~vY'Yo?b"V[ߘToTvcw{t@\V[oThQYBZ02042006-2016Z550ёRaQ|7KQ/201803023_lzhXoNޏ gPlQS3%fl;SoFU:WkSuoThQ-Nobe6RBR,{ASVQ551F2| ͑^NeoNN gPlQSk15KQ1804063%f^)ROo^552^V  TgwCQ6Ro gPlQS20180121 m3W^Oz_oN gPlQSV[ߘToTvcw{t@\hQYBZ0412200955320180911 m3W^^SS;So gPlQS55420180128 Vn:S)Y)Yzof'Yo?bBhW^555k|ň0.31g180706V[ߘToTvcw{t@\hQYBZ06472009556QwupV  TgwKQoN gPlQS557RwxXbm\Gr)YXbeON Ty?e)R^6Ro gPlQSSXbeON Ty?e)R^oN-NV gPlQS1804A34558 swm TnoN gPlQS20180405559Xj~uT| ^}vNq\v^oN gPlQS180812 3%f^]\R`l'Yo?b560aSXbnf)RGr 20181101B561181105562VoƖVUl4Yёw6Ro gPlQSSUl4Yёw6Ro;`S ln^]Sd^GdTQgkSuz563_^X2+Tul ^]}vNq\leOXoNN gPlQSk/e20ml +T;NbNul52.8-58.3%͑ϑ/͑ϑ B02022 V[ߘToTvcw{t@\V[oThQWS1-XG-018-2011564bukS gm [_NvS6Ro gPlQS  T^WS[!n8luXo^565b[poVk|ň0.75g(+Tr^xm0.375g)"V[ߘToTvcw{t@\V[oThQYBZ11882006-2010Z566k|ň0.75g+Tr^xm0.375g 180814m3W^~vY'Yo?bޏ gPlQS TPNR^ 0V[oThQ 0eolckhQ,{90Q567bXuGrn܏'YSgޏo^ gPlQSޏWSzeWR^568180911569ޏ]^^eyo?b570  TgsN6RoN gPlQSn܏^ne:S*YTG}Y__eP^o?b571 y3t( Ye(lZ }Gr)=kGr+T[YNp(lWZ250mg, e4lTaUV30mg, vxS'l Nz }5mg, legx/lOe2mg, ~u }B1 3mg8CS3ۏSoTlQhQJX200900105728CZ4573TyrupVk|+T\Sir^xm360kKQ legx/lOe1.4kKQ_^SQgG^Xo^_WMRTWR^574180105 0-NVoxQ 02015t^HrN,{1183u575k|+T\Sir^xm360mg legx/lOe1.4mgn܏'YSgޏo^ gPlQS_x^yR^576180505577 ^o(u iirV6RoS ޏq\XevteꁻlS?no^578TyrupGrkGr+T\Sir^xm180mg legx/lOe0.7mgL18J212579580 ^m6RoN gPlQS581KQTV 5]vpO6RoN gPlQS180608\  0kSuoThQ 0-Nobe6RBR,{ASNQWS3-B-3215-980oxQNS2001 ,{015S0oxQNW[2001,{388S0oxQNS;2003=373SSoxQNS;2003=403S 582180610_l'YSgo^ gPlQSdq\SR^583KQTGrkGr͑0.46KQswm V&OoNƖ< VIQi_'Yo?bޏ gPlQSz_OgR^4 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t@\oTheEQhelThyvybQN2009031S584kGr͑0.54g20181033`]^NN~vY'Yo?b gPlQS585 KQg }xxol\m2ml:0.3gNKQg } 586KQ( bx̖NGr/̖NsNU[nGr YTSň)DELPHARM Lille S.A.S.630BۏSoTlQhQJX20170197587Spn|10g/D18A0013_l^3N:SNWGN1rXo?b588SpnGr18012202V[ߘToTvcw{t@\hQYBZ13362009589SGr  TgwR܀6Ro gPlQS |cGr Gr_͑0.30g20170507590kGr͑0.26gvS_NnGr1g 171105- 0-NVoxQ 02015t^HrN0V[ߘToTvcw{t;`@\oTeEQ3uybN2016B01445591dW Y^GrkGr͑0.45gcGr #V[ߘToTvcw{t;`@\V[oThQYBZ07732006-2015Z592bs|+Y[GrVnWSCSёXn_loNN gPlQS171102m3W^WSSoLޏ gPlQSWSSoL'YO^R^593 V(lxxx"l|vxV(lx0.1KQ xx"l0.1KQ20171003 [n_l^aW4Y:SWST%fXo^594lQYGr܏'Y;SoĞwޘN6Ro gPlQS T'YSgޏo^ gPlQSO[-NtQRlQSV[oThQWS3-B-3350-98-2011595)R]旗g|180341 wm0NSWN_9ho^596180415sQ^'YSgo^ gPlQSf_lChVR^597)R]旗gl\m 1ml:100mg181230598 1ml100mg m3W^Oy^;So gPlQS599 _lςm4l6Ro gPlQS1806134160031712111601ޏnvV w[^N\oNN gPlQSA1812112^NeP;Soޏ gPlQS_^[)W^602ޏ%k8N Y^oNƖVd\9NoN gPlQS9g/1810025V[oThQWS3-B-3599-98-2011603P[VoƖVQN'`([Oq\)oPgnGr gPlQS604xxNTgGr20kKQNC21H27NO F180501 W[^DW_,gXo^ 0-NVoxQ 02015t^HrN,{1572u605xx]UGr171103sQ^aNN'Yo?b;Soޏ gPlQSel^! 0-NVoxQ 02015t^HrNSoTeEQ3uybN2004B04211606up9NI| NWSvNwmoN gPlQSkň3gm3W^-NT'Yo?b gPlQS-NT'Yo?bJS\WR^607 kxx?s|aSfl\m% cC[22]H[43]N[5]O[13] 2ml0.2g20NUSMO ( 0-NVoxQ 02015t^HrN0V[ߘToTvcw{t;`@\hQYBH02842013608kxx?XbTGr mg]luoN gPlQS0.3mgT18A043-Nq\'Yf[D^\,{N;Sbm3W 609T18F015 ^NkQGl;So gPlQS 0-NVoxQ 02015t^HrN,{1336u610 kxxaS }l\m2ml:0.5g(50NUSMO)41807032Ul4Y^no3:ShSNS)YoNޏs^So^611kxx"l/l!T 0~V(ϑhQ 0oxQNS2000 ,{319SSV[ߘToTvcw{t@\oTheEQhelThyvybN2008008669k|ň0.5g+TvxXbTn50mg C80069< `ƖSS`oN gPlQSoxQNS2000 ,{319SeD(ϑhQ670<\)R| ς]OloN gPlQS180411 [n_l^dNW:Szzo^V[oThQWS1-(X-068)-2002Z-2011671 <\ T(<\0Ws^l\m) 50ml:10mgBXJ7441ۏSoTlQhQJX20160344672<\0Ws^Gr蕿Ss^uWS>y:SkSu gR-N_673 i`s^^i`W TNmXo^674<\0Ws^GrYtQS\o^675190203676 NwmhQ[uirybnxq\6Ro gPlQS1806281677?\w8Nkň4g20190106#V[ߘToTvcw{t;`@\V[oThQYBZ01022003-2015Z678[r'YR679[rĞkGr; 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t@\oTheEQhelThyvybNS200800902008013680\Gr; 0-NVoxQ 02015t^HrN0V[ߘToTvcw{t@\oTheEQhelThyvybQN2008009S20080136815]~vupONƖV6RoN gPlQS20180210682VO^NW:S~vV'Yo?bv\^; 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t@\oTheEQhelThyvybQN200800902008013683 lWSw~vl6Ro gPlQS; 0-NVoxQ 02015t^HrN0V[ߘToTvcw{t@\oTheEQhelThyvybQN20080090200801368420180502 -Nq\^SG^o?b3 0-NVoxQ 02015t^HrNSV[@\oTheEQhelThyvybQN20080090200801368520180607: 0-NVoxQ 02015HrNSV[ߘToTvcw{t@\oTheEQhelThyvybQN2008009S2008013686 Sey6Ro gPlQS@ 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t@\oTheEQhelThyvybQNS200800902008013 687  ToƖV'Y T6Ro gPlQSZ 0-NVoxQ 02015t^HrN0q\wߘToTvcw{t@\oTQlQybN2015R0034690V[ߘToTvcw{t@\oTheEQhelThyvybQN200800902008013688[rĞdžƀ]Gr _lO)R6Ro gPlQSkGr͑0.41KQ Sq\^^wmG-N_kSubV[ߘToTvcw{t@\hQYBZ07862008689[rĞvёGr q\N^XVo gPlQSkGr͑0.5g20180403 0kSuoThQ 0-Nobe6RBR,{ASmQQ690m3W^z0N'Yo?b gPlQSvR^691 m3WNSsO;So gPlQS692fÀPNGr470447 [n_l^dNW:StQVo?b693llfV1902576694180201^N1r_'Yo?bޏ gPlQSޏ]VeWR^695180402696 _l)YKNwmoNN gPlQS181006697180804 NO.061698 NwmvaR݄)Y6Ro gPlQS699 V]^yegoNƖV gPlQS1803031 0-NVoxQ 02015t^HrN,{1198u700cw| kň5ge| TA019701^Nln6Ro gPlQSS^NvTX6Ro gPlQS TA015702gwgbkTV 5]^yGYoN gPlQSk|ň0.25KQ171002Sq\^TtQo^703QbaGr ^NNt^R6Ro gPlQSkGr+T[YNp(lWZ40kKQ0legx/lOe0.7kKQ _^SNXoT gPlQS704aQoGr _lς)YXR^voN gPlQS100kKQ 201807091 0-NVoxQ 01995t^HrNS1997t^Xe,g705 201807061ln^W:SqMRXoN gPlQS'YehRlQS 0-NVoxQ 01995t^HrN706 201804252 0-NVoxQ 01995t^HrS1997t^Xe,g707 201810151708q\NefoNƖVN gPlQS1809061Nnm^Y|^OePRu gR-N_ 0-NVoxQ 01995t^HrN,{856u709a|x+TGr0.15KQ 201811100710a|xGr0.5gvS_N45mg hTQ\tʋ@b711 Ym_l^toNN gPlQS77161201712a|l\m20ml:10g1809049S]^lWSS\>y:SE\YO,{NkSuz7130W݄mpGr [_NmNoN gPlQS2180603!V[ߘToTvcw{t;`@\V[oThQWS3-B-0649-91-67142180813n܏~vY'Yo?b;Soޏ gPlQSXX^7152181134716 VnWSev6RoN gPlQS180347 m3W^eQl;Soޏ gPlQSAV[ߘToTvcw{t;`@\V[oThQWS3-B-0649-91-50V[ߘToTvcw{t;`@\V[oThQeEQ^N2015B1207171812221"V[ߘToTvcw{t;`@\V[oThQWS3-B-0649-91-12718 YXbeNWSS6RoN gPlQSSXbeNWSmoN gPlQS   0kSuoThQ 0-Nobe6RBR,{ NQWS3-B-0649-91 719 NWSS6RoN gPlQSn܏'YSgޏo^ gPlQS3q\*Ys^R^ 0kSuoThQ 0-Nobe6RBR,{ NQ720lQ񂗘| _l_ڋoN gPlQS [Oq\^z_:S'Yo[^o^V[ߘToTvcw{t;`@\hQWS3-B-1659-93-1721kň15KQ18072402 ^^'Ye:SPNXo^ 0kSuoThQ 0-Nobe6RBR,{kQQWS3-B-1659-93722lQGr kGr+Tr^xm0.3g -Nq\^WS4YGck'Yo^kSuoThQ-Nobe6RBR,{ NQ723nfPN[GrkGr͑0.64g+Tl܃|0.5g ZDA1815 n܏^nW:SNmN;So^724NS^y[Gr NWSyr[PT6RoN gPlQS kGr+T NNS;`v50kKQ  T^cke;So gPlQS725 NWS'YuiroN gPlQS kGr+T NNS;`v50mg170613726^gʃ0WĞ8N727MRetQS8ley-NonGrS gPlQS 0-NVoxQ 02015t^HrN,{265u728MRR^V_l'YSgo^ gPlQSeO]R^'V[ߘToTvcw{t;`@\V[oThQWS-5071B-0071 -2014Z729;m ^NNS_f-NonGr gPlQS730:_V w[^NeoNN gPlQS 01170526229%V[oTvcw{t@\V[oThQWS3-133(Z-133)-2002(Z)731:_R_^V S ToN gPlQSW3Gy[Xo^-V[ߘToTvcw{t@\V[oThQWS-10947(ZD-0947)-2002-2012Z732:_Rgwg2ktň150ml20190302733"l/l{VUGr20181108734 0-NVoxQ 02015t^HrN,{771u73520190101736170601737 "lnxSlV Uq\^yPNoN gPlQSk|15kKQ738 "lnxSl|Fm10kGS//eV[oThQWS{1}-X-341 -2003Z739nbkpGr NWSёg6Ro gPlQSkGr͑0.6g!V[ߘToTvcw{t;`@\V[oThQWS3-B-0418-90-1740741180645[Oq\^-N)YoNޏ gPlQSl^o?b742nkpV _loNT6Ro gPlQS7V[ߘToTvcw{t@\hQYBZ09122008SV[ߘToTvcw{t@\oTeEQ3uybNS2010B00183743171202<V[ߘToTvcw{t@\hQYBZ09122008SV[ߘToTvcw{t@\oTeEQ3uybNybNS2010B00183 744nkpGr VnWS[tQޘ=oN gPlQS1806042萁hQ-Nobe6RBR,{NQWS3-B-0414-90745kGr͑0.52KQ180825 V[ߘToTvcw{t@\V[oThQWS3-B-0414-90-4 746 _lNS*YoN gPlQS180923!V[ߘToTvcw{t;`@\V[oThQWS3-B-0414-90-1747 _lq\oN gPlQSkGr͑0.38gkSuoxQYXTO98 kSxQNW[,{429S748kGr͑0.31KQ 180603 10WSSoL_l gPlQSdq\NlR^V[oThQOybNS2000ZFB0014@bDhQ749kGr͑0.19KQ750  O%fёSo6Ro gPlQS18120372^Ne_OoNޏ gPlQS]_lZo^751nkphGr ^Nml6Ro gPlQS ZSWSw~nGP0No^752[Oq\^WSwm:S 3t;SQyʋ@b753754kGr͑0.20g 201803313/ 0-NVoxQ 02015t^HrNS_lwߘToTvcw{t@\oTQlQybNS2015R001164755 V]e3oN gP#NlQS18100401756nQ2f|}vNq\TĞW6RoUl4Y gPlQS180210 3%f^N{X'Yo?b 萁hQ-Nobe6RBR,{]NQWS3-B-1840-94  757nQUGrkSuoThQ-Nobe6RBR,{ASNQ758nQl _lOnoN gPlQSkvň3g20180501m3W^-Nn'Yo?bޏ gPlQSl~nR^759< WSwm\e;So gPlQS C005180502m3W^z0N'Yo?b gPlQS)YN[R^760nm|ў_lLNς̑_l6Ro gPlQST\nRlQS20190105 m3WwmseP;So gPlQS761npfuV  Tg~v&toN gPlQSV[ߘToTvcw{t@\hQYBZ08412008762npkS gm9F33202763 fkIl*Yy6Ro gPlQS764npce~GrhT)Rl*NSOʋ@b765181035766npmp[Vk|ň0.32KQY06310 i`s^^TXGNڋo^V[ߘToTvcw{t;`@\hQYBZ00582013767n)wGrkGr͑0.48g18100009768y4lNxGrSHr~Hr~oN gP#NlQS180110769[yubkTV190301V[ߘToTvcw{t@\hQYBZ09642009770SuGr37180519771'kGr+T(lWkg150mg0^N150mg0TaUV50mg0]kY15mg37180802W[^v^o^ 0kSuoThQ 0Sf[oTS6RBR,{NQ,{20u7721801121ln'YSgo^ gPlQSIN[R^773170727774NSeP>8NSN TNXN gPlQS TNX6RoSk8N͑6KQ17015697775 N][rĞ2u]xUV -Nq\^WSgG[hX'Yo?bV[oThQWS-10001-(HD-0204)-20027762u]xU0.2g N][rĞ5mg`]^Nz`ؚe:SN_lNNVT^oL777 ͑^ꏷ^_l6Ro gPlQSk|+T2u]xU0.2g N][rĞ5mg778779sN~lV ^ f_6Ro gPlQS 2018/04/20V[ߘToTvcw{t@\hQYBZ00502009780sN^8N  TgwO[oN gPlQSk1008N͑5g20170601" 0-NVoxQ 02015t^HrN0 0V[oThQ 0eolckhQ,{102Q781sN[Gr  Tgw~woN gPlQS kWGr͑0.32gV[ߘToTvcw{t@\hQYBZ04462008782sNVvmGr[ No}YbXoNƖV gPlQS783sNx̃ }Gr  csNx̃ }0.4KQ18110006 0kSuoThQ 0N,{mQQ784sNxOlTvUnm0.1%785^tON@lGr Ym_lNeoNN gPlQS cC22H28FN3O6S 10mgB1901113V[ߘToTvcw{t;`@\hQYBH05172018786mqbkuVk|ň0.5KQ-V[ߘToTvcw{t@\V[oThQWS-10029(ZD-0029)-2002-2011Z787 NTTVGr _llNmoN gPlQS kGr+TsNx0.05KQ0a|x0.05KQ0xx"l0.05KQ788 NĞGr3 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t@\oTheEQhelThyvybQN2007002789 VO^NW:SNSXo^790171201+ 0-NVoxQ 02015t^HrNSV[@\oTheEQhelThyvybQN2007002791792 ^NwɃܔNlQS;Sb793794 VnSN`oNN gPlQSc\Gr kGr͑0.26g171104^NsQ1r'Yo?bޏ gPlQSneV%fRlQS< 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t@\oTheEQhelThyvybQN0S2007002OHr 07957968 0-NVoxQ 02015t^HrN0V[ߘToTvcw{t@\oTheEQhelThyvybQN2007002OHr 797180803798 cGr kGr͑0.26g ^^Vn:S^KNf'Yo?b7998009 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t@\oTheEQhelThyvybQS2007002S(OHr)801 m3zRoN gPlQSX 0-NVoxQ 02015t^HrN0V[ߘToTvcw{t@\oTheEQhelThyvybQN2007002SOHr SlWSwߘToTvcw{t@\oTQlQybN2015R001686802 W[^cks#WXo^7 0-NVoxQ 02015t^HrN,{494uSV[ߘToTvcw{t@\oTheEQhelThyvybN2007002803wocƖVlSUZoN gPlQSD14020VocV'Yo?b_lޏ gPlQS_s^_NSR^804 Ul4Y^no3:ShSylo^805806 N[oNƖVN gPlQS181116[Oq\^eP^N~;So gPlQS^ؚe:SRlQS807  NxxzNl\m2ml20mg1901151808 NN$OoGr [_NToN gPlQS809 Ndžƀ]|Fm10ml/t190203-1 0kSuoThQ 0-Nobe6RBR,{ NQ,{14u810Qh[u811QhYaQGr OTcu6RoN gPlQS18011515812QhʃaQGr813lnQ6TB005 V[oThQWS3-B-3595-98-2016 814xN815q\~6MSV ^N[XoN gPlQSk|ň0.43g160901V[oThQYBZ15792005-2011Z816q\oѐ]^t6RoN gPlQSN0WlWS 18120701817$Oy̍SbGr VnWS[6Ro gPlQS818$OycGr 'YޏW-NoS gPlQSkGr͑0.33g20180506 BnSWgey%fo^819džƀ]mktň100ml190302"V[ߘToTvcw{t;`@\oThQWS3-B-1832-94-2016820Θ^N[n_l TloNN gPlQS 9.5Ss|11.6Ss|A19026821^yQGu 10Ss|14Ss|A19043822 NzrYGr _lςN1rnfhoN gPlQS2.5mg1811044823w|k͑15g824u0WĞ^Nes6Ro gPlQSN0WlWS 825_lzyX-NonGr gPlQSN0WlWS 826u nZQSe VnSy^6Ro gPlQS20181006  T^5u}v:S^[X'Yo?b827npGr ^NT^oN gPlQS |cGrGr͑0.25g `]^`3:Sm4lNS['Yo?b-V[ߘToTvcw{t@\V[oThQWS-11030(ZD-1030)-2002-2012Z828ASn4lk/e5kGS829180419830AShQ'Ye8NVoƖVQN'`[Oq\ oN gPlQS160006831wmGr kGr+Tr^xm0.12g832K{;m@GrkGr͑0.37g#V[ߘToTvcw{t@\V[oThQWS3-B-2624-97-2011833q0WĞ834835SIsZt+TGr&V[ߘToTvcw{t@\V[oThQWS-5402B-0402 -2012Z836S/lxnGr}vNq\dl4NloN gP#NlQS170802 0-NVoxQ 02015t^HrN,{99u837838839S/lxʑGrVoƖVTm3W jWq\6Ro gPlQS093184657V[ߘToTvcw{t@\V[oThQWS1-(X-046)-2001Z-2011SVoxQSS[2012]202S84009318627`]^`3:S fvXo^'YWWSR^8414lޘ߄[V )Y%m)YXR#Wyr6Ro gPlQS k|+T4lޘ߄[35mg 850708166 W[^ST;So gPlQS 0V[oThQ 0eolckhQ,{NASNQ,{36u842Vc[aQV180335"V[ߘToTvcw{t@\V[oThQYBZ03932005-2009Z843Vc[aQGr 'Y T'YnoN gP#NlQS!V[ߘToTvcw{t;`@\V[oThQWS3-B-2499-97-4844 ў_l)Y[oNN gPlQS20180107V[ߘToTvcw{t@\hQYBZ12052009845 %fNloNƖV gPlQSkGr͑0.35KQvS_NnGr1.418KQ ؚe:SeN{Xo^V[ߘToTvcw{t@\hQYBZ00342014846Vc[ NĞGr kzfؚoN gPlQSGr͑0.3g!V[ߘToTvcw{t;`@\V[oThQWS3-B-3795-98-3847kGr͑0.29gvS_NSoPg0.572g 180422!V[ߘToTvcw{t;`@\V[oThQWS3-B-3795-98-48482uSfWGr0.25KQ849250kKQ 0-NVoxQ 02015t^HrN,{1486u850)l8Nk20|͑1g851uTQGr Tg}vq\ckoNN gPlQSkGr͑0.2g+TTaUV20mg 852xx"lGr1810003wm0NSck_o^853 lS)YboNN gPlQS0.5KQ/Gr71711202 0-NVoxQ 02015t^HrN,{1502u854 VnWSIlh6RoN gPlQS1809201855856 [n_l^z:S%fVfo^8571809222858ĞeP8N  TgwkoN gPlQSk8N͑3.5g20180207859)YV  TgNckoNƖV gPlQS170837"V[@\hQWS<sub>3</sub>-B-0500-91-2004860)YGr861862863)Y4YuGr ar9N_luploNN gPlQS. 0-NVoxQ 02015t^HrN0ў_lwߘToTvcw{t@\oTQlQybN2015R00251586< 4OupV of_q\VoUq\ gPlQS^NsQ1r'Yo?bޏ gPlQS[OQnR^865 N[oN*YS6Ro gPlQS866I ^NT6Ro gPlQSHX18B02867z;p| bꏷ^oN gPlQSkň2KQ180113868z;pGr  Tgw~g6Ro gPlQSkWGr͑0.3g20180802- 0-NVoxQ 02015t^HrN0 TgwߘToTvcw{t@\oTQlQybN2015R006726869UvoNƖVN gPlQS20181201 `]^eoN gPlQS870 SeZoNN gPlQSkGr͑0.3gvS_NnGr1.1g 181007 -Nq\^ĞWGNe'Yo?b871 OckoNƖVN gPlQS872 NWSoN gPlQS3 0-NVoxQ 02015t^HrNSNWSwߘToTvcw{t@\oTQlQybNybNS2015R003081 873201810040 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t@\oTlQybNybNS2006S06536 874z3K8Nk100|͑6g201701098754Yb[(lĂV0.125g cC16H17N3O4S 1902533876877878879 VnWSy&O6Ro gPlQSF180705880171804088814Yb[KToVVoƖVTm3W 6Ro gPlQS cC16H16N4O8S 0.125gA1902158824Yb[KToGr cC16H16N4O8S 0.25gA190302V[ߘToTvcw{t;`@\hQYBH06302017883A190304V[oTvcw{t@\hQYBH057820188844Yb[KQmr^m`BR eR^972TfNV 0-NVoxQ 02015t^HrN,{348u973974TfNGr975976TfNl\m2ml:0.2g1901281977 UOy[(8TeQ(uNlp)!Maruishi Pharmaceutical Co., Ltd.ۏSoTlQhQJX20140335978YQhʃ| ^NS]-NoS6Ro gPlQS20180705979980180423 WSĖ^Ė]WSlNX'Yo?b98110KQ/190108 0-NVoxQ 02015t^HrN,{1344u982983 T^5u}v:S4lNGeP^no^984985PA10076(uNeg20180331)^N Tڋ;Soޏ gPlQSUl4Y^NՈVR^986NupFV-V[ߘToTvcw{t@\V[oThQWS-10269ZD-0269)-2002-2011Z987x{QÀ8N m3[zoN gPlQSk50|͑3g 3q\S_lG_fo^988m4n8Nk108N͑2.5g (+Ty:SE\YOkSuz"V[oThQWS-10001-(HD-0214)-2002-2006102820180609[n_l^q\:S_ckX'Yo?b gPlQS$ 0V[oThQ 0WS-10001-(HD-0214)-2002-200610291030uoNƖV͑^ gPlQS$k+T[YNp(lWZ125mg legx/lOe0.5mg N][rĞ5mg0170395! 0V[oThQ 0Sf[oT0WehQ NGSV[hQ,{ NQS,{ASmQQRh1031uoNƖV͑^\u?Qz6Ro gPlQS [YNp(lWZ125mg,legx/lOe0.5mg,N][rĞ5mg171071* 0V[oTvcw{t@\V[oThQ 0Sf[oT0WehQ NGSV[hQ,{ NQS,{ASmQQRh1032 q\}Y;SuoN gPlQS10331034 SN[oNN gPlQS7k+T[YNp(lWZ125kKQ legx/lOe0.5kKQ N][rĞ5kKQ0e:N|0IsT| Z~nK30180807" 0V[oTvcw{t@\V[oThQ 0Sf[oT0WehQ NGSV[hQ,{ NQ1035 Ym_lN\oS gPlQS [YNp(lWZ125kKQ0legx/lOe0.5kKQ0N][rĞ5kKQ&V[oTvcw{t@\V[oThQWS-10001-(HD-0214)-20021036\?QaQ| u\wm6Ro gP#NlQS 3%f^ǑSWs^N'Yo?b1037041804491038\?Qkce *YS'Y[XoN gPlQSkň0.3g1 0kSuoThQ 0-Nobe6RBR,{kQQ0q\wߘToTvcw{t@\oTQlQybN2015R0026651039\?QTUup| N^ё;So gPlQSG V[ߘToTvcw{t;`@\V[oThQWS3-B-0688-91-12SV[ߘToTvcw{t@\oTheEQhelThyvybQN2009031 1040kň2gvS_NnGr6.37g =V[ߘToTvcw{t@\hQYBZ05192017SV[ߘToTvcw{t;`@\oTeEQ3uybNybNS2017B03151 1041\?QNf6|kň7gm3W^8leyo?bޏ gPlQSjNR^1042m3W^8leyo?bޏ gPlQS4l>\R^1043kň7KQ1805017 0-NVoxQ 02015t^HrN,{526u104410451811008^NeP;Soޏ gPlQSؚXX^1046\?QnSu| ^yZoNƖV gPlQS18111212 3SXXSc fo^kSuoThQ-Nobe6RBR,{ASNQ1047\?QnpbkTTBR  T^WSNmWSXo^1048\?QTAb| VnWS^\sO6RoN gPlQS1049 q\ȏ6Ro gPlQSkň4KQ521876 [n_l^q\:SЏXo?b1050\?QbkT|Fmy]wmsёa-No6Ro gPlQS181121/ 0-NVoxQ 02015t^HrN0y^wߘToTvcw{t@\oTeEQ3uYHhNY2017000191051l\P\V20171202-V[ߘToTvcw{t@\V[oThQWS-10292(ZD-0292)-2002-2012Z1052_[8N ^N*Y[XoNN gPlQSk8N͑60kKQ C201812031053| Ym_lO܀yr-No gPlQSkň20KQ181107 D [n_l^dNW:S^uoL" 0-NVoxQ 02015t^HrNSoTeEQ3uybNS2013B000811054e Ye'YRSGr c f6RomZS gPlQS8kGr+T Ye'YRScSir200mgNp(lWZ75mgTaUV7.5mg_ b]kY7.5mg~u }C10mg170407$V[ߘToTvcw{t;`@\V[oThQWB3-B-1057-91-20151055e Ye_V lSN Y4NoN gPlQSk|ň0.43KQ1706128Nnm^'YSgo^ gPlQS>e-NR^"V[ߘToTvcw{t;`@\V[oThQYBZ00012012-20151056eGr TgwSZSeyoNN gPlQSkGr͑0.56g170102V[ߘToTvcw{t@\hQYBZ044520081057e8N [N6Ro gPlQSkň1.7KQ17010217"V[ߘToTvcw{t@\V[oThQYBZ25552005-2012Z1058e@[V1802061059OgςbkT|190114 0-NVoxQ 02015t^HrN,{934u1060suTh|1061180205106218070026 0-NVoxQ 02015t^HrN,{811u1063*YgƖV͑^-NoNS gPlQS18091081064͑^y^tNT6Ro gP#NlQS1065@^XGr180510  0kSuoThQ 0-Nobe6RBR,{ASNQWS3-B-3207-981066Tp+TGr [ZS1r6Ro gP#NlQS kGrvS_NSuo2.6gP1807046 0kSuoThQ 0-Nobe6RBR,{ASNQ1067TpGr T\n NPNuir] z gPlQS20180611 0kSuhQ 0-Nobe6RBR,{NQ,{161u1068"V[ߘToTvcw{t;`@\V[oThQWS3-B-0331-90-171069  Tg^4T*Ya^oN gPlQS!V[ߘToTvcw{t;`@\V[oThQWS3-B-0331-90-11070107119020160V[ߘToTvcw{t@\hQYBZ024820031072TpnGr5]~vupONƖVTNXoN gPlQS20170506-V[ߘToTvcw{t@\V[oThQWS-10329ZD-0329 -2002-2011Z1073 vx(ln"}S gnm lb]^ No6Ro gPlQS 100kGS0.3KQ 20180724-3 0-NVoxQ 02015t^HrN,{1059u1074vx(ln"}Gr q\NՈ#koN gPlQS 6180720241075 vxwmbfl\m1ml20mg61810161-Nq\^lO;Sb1076vx0W<\YGr1077 vxY]ZNl\m 2ml19021511078 vxN2uS̀nV SN#W8l6Ro gPlQS18091012 -Nq\^'YmG)YLePo?b-N_10791811599) 0-NVoxQ 02015t^HrN0V[ߘToTvcw{t@\oThQYBH095820091080 vxN2uS̀nGr 5])Y[oNN gPlQS201810481081 0.25gNC4 H11 N5 HCl  <    20181049n܏'YSgޏo^ gPlQSGSs^R^1082 vxN2uS̀ʑGr14880630"V[ߘToTvcw{t@\V[oThQWS1-(X-035)-2010Z1083vxN2uS̀Gr SNN0N6RoƖV gPlQS180723ln^ޏs^S N]N'Yo?b gPlQS10841085180735YtQS~[o^108610871088180531 -Nq\^;S#WX'Yo?b108918031301090181056610911811614- 0-NVoxQ 02015t^HrN0^NwߘToTvcw{t@\oTQlQybN2015R0038031092vxlBh)RUV q\%mNSVff6Ro gPlQS5mg(N[C26H26F2N2])1093 c[C26H26F2N2]{5mg1094vxlBh)RUGr ^N\WS6Ro gPlQS 5mgNlBh)RU 9350011095vx<\fNV 0.15KQN<\fN 1810246^NeP;Soޏ gPlQS^[Nl^1096 0.15gN<\fN 18102531097 0-NVoxQ 02015t^HrN,{1106u10981099  NwmvaR݄6Ro gPlQS 0.15KQ c<\fN 1100 vxgS }l\m cC18H34N2O6S{2ml:0.6g18032711101vxTIÙGr180107ln^ޏs^S_OGNcks^N'Yo?b 0V[oThQ 0Sf[oT0WehQ NGSV[hQ,{NQ11021103" 0V[oTvcw{t@\V[oThQ 0Sf[oT0WehQ NGSV[hQ,{NQ1104vxnfm\GrE181116 0-NVoxQ 02015t^HrN,{1097u1105 vx2uUIUUBR 10ml5mg150U k1U+Tvx2uUg0.033mg  0V[oThQ 0eolckhQ,{51Q1106vx[^vUGr 2kKQ cvx[^vU 180804 ln^Ts^SXGl0No^1107vxf)RUGr bR`^t6Ro gPlQS1108vx\jxGrNS6RoƖVl3,{N6Ro gPlQS2180516 0-NVoxQ 02015t^HrN,{875u110921711071110218110411111112vxn]eGr N_6RoƖVN gPlQS8mg B01A1610191113vxYNNGr `]^VloN gPlQS1114111806031115vx]eTUGr1116170508 ln^]SbGV%fo^1117111811191120170507n܏^nW:SnmoG:Nl'Yo?b1121170602e0NSl0uo^1122G1610021123vx]eTU|Fm 10ml20mg [n_l^aW4Y:SĞ^['Yo?b1124{Q@[^yGrWGr͑~0.25KQvS_N;`oPg1.1KQ 1125'l c3^_llSOS gPlQS201903171126201903191127Αʃ|1805202$ 0V[oThQ 0WS-11433(ZD-1433)-2002-2012Z1128Α(gtGr ^NTs^oN gPlQS kGr+TΑ(gtr^xm0.4g11299 0kSuoThQ 0-Nobe6RBR,{ASVQSV[ߘToTvcw{t@\oTheEQhelThyvybQN2009019S1130Gr͑0.42gkGr+TΑ(gtr^xm0.4KQ ln^]SW_Rʋ@b)V[@\oThQWS3-B-2777-97-2SV[@\oTheEQybQN2009191131SёcwV l3NuoNN gPlQS(V[ߘToTvcw{t@\V[oThQWS3-334-(Z-044)-2004(Z)1132Nn|kň7.5KQ 0-NVoxQ 02015t^HrN,YBZ128220091133kň7.5g201902051134NnoV wmWSwm^y T2m6Ro gPlQSk|ň0.65g1801252$V[ߘToTvcw{t@\V[oThQYBZ11792005-2012Z-21135OXb~ }| VnSNOoN gPlQS cC37H67NO1375mg7.5NUSMO 3%f^%fW_No^1136OXb~ }Gr cC37H67NO13{0.125g 12.5NUSMO 11181207  T^n^;So gPlQS1137YNpe }Gr 0.1g10NUSMO 1138_pGr0.1g/Gr160903 0-NVoxQ 02015t^HrN,{413u1139yCQoN gPlQS [n_l^z:SlTX'Yo^1140 l3~e6Ro gPlQS100mg/Gr16070111141vkInGr 1142vkI|YtQSOgo^11431144 vkI|e|W V[ߘToTvcw{t;`@\hQYBZ001320151145vl~@V ^N~sZtoN gPlQS"V[ߘToTvcw{t@\V[oThQYBZ25342005-2009Z1146vl~@|20181225  0-NVoxQ 02015t^HrN! 1147gV ^[^tfW6Ro gPlQSk|ň0.48KQV[ߘToTvcw{t@\hQYBZ110820081148ĞVV[oThQWS3-B-3692-98-191149Ğ|k͑4g201903011150k|1902204115111521153k|ň15g1154kGrkGr͑0.52g180041155OgSGrkGr͑0.21KQ+T;`Ğn9.6mg0{|Qo2.4mg < 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t;`@\oTheEQhelThyvybQN2015001020150071156kGr+T;`Ğn9.6mg0{|Qo2.4mgH 0-NVoxQ 02015t^HrN0V[ߘToTvcw{t;`@\lQJT2015t^,{66S DNSV[ߘToTvcw{t;`@\lQJT2015t^,{142S DN61157 TgwckToNƖVN gPlQS 蕿S0W>mG0W>mQgkSuz1158m11592T^Gr1160180444`]^`3:S fvXo^S:c-NR^116118040371162 Ym_lNeoN gPlQS-Nq\^sONmo^11632TTnGr 0-NVoxQ 02015t^HrN,{479u11641165tZ?Q } NWSNՈoN gPlQSkň0.5g 1705003 1051166 O~>f(xnfWl\m) 50ml:31.17gKT0247KۏSoTlQhQJX201003081167aΘ[_8N k108N͑1.5gYOQyʋ@bV[oThQYBZ094820081168aVI y[oNƖVpSSZioN gPlQS20170902 -Nq\^WS:S$*mo?b[oThQWS1-X-047 -2005Z1169CQbkuV V]lPN6Ro gPlQS _l^eO:SOW~GSo^1170CQbkuGr [3oN gPlQS4 0-NVoxQ 02015t^HrNSV[ߘToTvcw{t;`@\oTheEQhelThyvybQN20140041171 ^SoN gPlQS |cGr Gr_͑0.25g1711314 0-NVoxQ 02015t^HrN0V[ߘToTvcw{t;`@\oTheEQhelThyvybQN20140041172' 0-NVoxQ 02015t^HrNSV[@\oTeEQhelTyvybQN20140041173 |cGrGr_͑0.25KQ 171207( 0-NVoxQ 02015t^HrNSoTheEQhelThyvybQN201400411741175gIl8N  TgNoN gPlQS 0.3gNgIl ^NN[X;Soޏ gPlQS N҉)WR^1176v҉:R ^NGl^CQoN gPlQS160301  T^`lXoLNlSR^1177^NGl-NonGrN gPlQS[n_l^~*Y3oNޏ gPlQShɃ>ee0^1178sʃMSGr1801191179hP[ё8N q\NT[#WX6Ro gPlQS1180180303811811901002118218110821183_YGr b0WeY]Nl6RoS1804021-V[ߘToTvcw{t@\V[oThQWS-11524ZD-1524 -2002-2013Z1184bkTgwg|1185 ^]l6Ro gPlQSk͑10g1186bkl|1805008 0kSuoThQ 0-Nobe6RBR,{]NQWS3-B-1699-9411876RILNQq\ek-NonGr gPlQS N0WV]11886RUOLN11896R }Gr Ym_lCQ6Ro gPlQS50NUSMO180719 V[ߘToTvcw{t@\V[oThQWS1-XG-056-20111190puI S]^Nm-NonGr gPlQS1191puIuI 1192u[Vk|ň0.33g 0V[oThQ 0eolckhQ,{91Q1193upmGr l^oNƖVN gPlQSkGr͑0.53KQ"V[ߘToTvcw{t@\V[oThQYBZ14402005-2012Z1194u[V lSeYfƖVoN gPlQSk|ň0.28g#V[ߘToTvcw{t@\V[oThQWS3-B-3872-98-2005<1195Ou8N#V[ߘToTvcw{t@\V[oThQWS3-B-2880-98-20111196͑aupGr uw\6Ro gP#NlQSWGr͑0.25g(+T[CNя50mg)710079-V[ߘToTvcw{t@\V[oThQWS-10872(ZD-0872)-2002-2011Z1197 ^N V^6RoN gPlQSkGr+T[CNя31.25mg legx/lOe0.375mg20181005#V[ߘToTvcw{t@\V[oThQWS3-B-3641-98-20031198kGr+T[CNя31.25mg0legx/lOe0.375mg01199l\(u?GY } cC38H72N2O12 0.25g718072131200l\(ueYbU ^N[܏ƖVoN gPlQS 40mg( cC17H19N3O3S)    181205031201 VnWSN2moN gP#NlQS cC[17]H[19]N[3]O[3]S 40mg1811174120240mg1203l\(u?\ov25NVEUSMO1204 l\(uTbgNU]fW1 2.25gC23 H27 N5 O7 S 2.0gNC10 H12 N4 O5 S 0.25g       #$ &' )903083041205/ 4.5gC23 H27 N5 O7 S 4.0gNC10 H12 N4 O5 S 0.5g       "# %& (903084021206l\(u4Yb[KT0.75g12071.5g1208l\(u4Yb[f~g cC18H18N8O7S3{1.0g12091210l\(u]xnf 50mg[ cNa2Fe(CN)5NO2H2O]   190227031211Xbkuk _710Ss|3V[ߘToTvcw{t@\V[oThQWS3-B-2689-97-2006SVoxQ-NS[2009]146S1212XpePGr1213XpeP8N^h] NdoNN gPlQS) 0kSuoThQ 0-Nobe6RBR,{ NQSV[oxQYXTOoxQNS2001 ,{578S1214Θ~;m@Gr TgwWSuSoNN gPlQS 0951805021215Θ8Nk108N͑1gA080471216]2urz }Gr100g1812690 0V[oThQ 0eolckhQ,{58Q121750g1810550 ; H U c)Ror{FD . v"z Gkr3,\8G U<bp[|g׈ -ȯ+n 1   %C!S4FcYks~ +;%7KJ\[ok{#(3;MC`rSۗco'  dMbP?_*+%&Q?'{Gz?(?)?" dX333333?333333?& U} G}  H} H} I}  I} H} H}  J} I}  G oTT Th:yuNON Ty &**  lF      @                   !"#$%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\]^_`abcdefghijklmnopqrstuvwxyz{|}~      !"#$%&'()*+,-./0123456789:;<=>?@ABCDEFGHIJKLMNOPQRSTUVWXYZ[\]^_`abcdghj             K K K K K K K K K X M M N N M M O N X P P Q Q P P O Q X M M N N M M O N X M! M" N# N$ M% M O N X& R! R' S# S( R) R* O S+ X, M- M. N/ N0 M1 M2 O N X3 M4 M5 N6 N7 M5 M O N8 X9 M4 M5 N: N; M5 M O N8 X< T= T> U? U@ TA T O NB XC M= M> N? ND ME M O NF XG M= MH N: NI M5 M O N8 XJ M= MK N? NL MM MN O NO XP V= MQ WR WS MT M O NU XV M= MW N? NX MY M O NF XZ M= M[ N? N\ M] M O NF X^ M= M_ N` Na Mb M O Nc Xd T= Te Uf Ug Th T O Ui Xj P= Pk Q? Ql Pm P O Q Xn M= Mo N? Np Mq MN O NO Xr T= Ts U? Ut Tu T O NB Xv M= Mw N? Nx My MN O NO Xz M= Mw N{ N| M} M O N~ X P= P. Q Q P P O Q X M= M N N M M O N X M= M N? N Mq MN O NO X M= M N? N M MN O NO X T= T U? U Tu T O NB X M M N N Mq MN O NO X M M N N M M O Nc X V Ms W W M M O NU Y P P P P P P P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ ! " # $ % & ' ( ) * + , - . / 0 1 2 3 4 5 6 7 8 9 : ; < = > ?  Y P P P P P P P P !Y !P !P !P? !P !P !P !P !P "Y "P "P "P "P "P "P "P "P #Y #P #P #P# #P #P #P #P #P $Y $P $P $P# $P $P $P $P $PF %Y %P %P %P# %P %P %P %P %P &Y &P &P &P# &P &P &P &P &P 'Y 'P 'P 'P# 'P 'P 'P 'P 'Pc (Y (P (P (P (P (P (P (P (P )Y )P )P )P )P )P )P )P )P *Y *P *P *P *P *P *P *P *PO +Y +P +P +P +P +P +P +P +P ,Y ,P ,P ,P ,P ,P ,P ,P ,P -Y -P -P -P~ -PA -P -P -P -P .Y .P .P .P~ .P3 .P .P .P .P /Y /P /P /P /P /P /P /P /P~ 0Y 0P 0P 0P? 0P 0P 0P 0P 0P 1Y 1P 1P 1P 1P 1P 1P 1P 1P 2Y 2P 2P 2P 2P 2P 2P 2P 2P 3Y  3P 3P 3P  3P  3P 3P 3P 3Pi 4Y  4P  4P 4P 4P 4P 4P 4P 4PU 5Y 5P 5P 5P 5P 5P 5P 5P 5Pi 6Y 6P 6PK 6P 6P 6P 6P 6P 6PO 7Y 7P 7P  7P 7P! 7P" 7P 7P 7P 8Y# 8P 8P$ 8P 8P% 8P 8P 8P 8P 9Y& 9P 9P$ 9P 9P' 9P( 9P 9P 9P :Y) :P :P$ :P :P* :P+ :P :P :PF ;Y, ;P ;P$ ;P ;P- ;P. ;P ;P ;PF <Y/ <P0 <P1 <P2 <P3 <P4 <P <P <PU =Y5 =P6 =P7 =P8 =P9 =P: =P; =P =Pc >Y< >P= >P> >P? >P@ >PA >PB >P >PU ?YC ?P= ?P> ?P? ?P@ ?PD ?PB ?P ?PUD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~@ A B C D E F G H I HJ K L M N O P Q R S T U V W X Y vZ v[ \ ] ^ _  @YE @P= @PF @P8 @PG @PH @PB @P @P AYI AP= APF AP8 APG APJ APB AP AP BYK BP= BPF BP8 BPL BPM BPN BP BP CYO CP= CPP CP8 CPQ CPR CPB CP CP DYS DP= DPP DP8 DPT DP DPU DP DP EYV EP= EPP EP8 EPW EPX EPB EP EPc FYY FP= FPZ FP? FP[ FP\ FPB FP FP GY] GP= GP^ GP? GP_ GP` GPB GP GP HYa HP= HPs HP8 HP HPb HPB HP HP IYc IP= IP IPd IPe IPf IPB IP IPU JYg JP= JP JP8 JPh JPi JPN JP JP KYj KP= KPk KP? KPl KPm KPB KP KP LYn LPo LPp LP8 LPq LPp LPr LP LP MYs MPt MPu MPv MPw MPx MPy MP MP NYz NP{ NP| NP} NP~ NP NP NP NP OY OP OP5 OP OP OP5 OP OP OP8 PY PP PP PP PP PP PP PP PP QY QP QP QP QP QP QP QP QPF RY RP RP RP RP RP RP RP RP SY SP SP SP SP SP SP SP SPc TY TP TP TP TP TP TP TP TP UY UP UP UP UP UP UP UP UP8 VY VP VP VP8~ VPHA VP VP VP VP WY WP WP WP WP WP WP WP WP XY XP XP XP8 XP XP XP XP XPi YY YP YP YP~ YP2 YP YP YP YP ZY ZP ZP ZP ZP ZP ZP ZP ZPc [Y [P [P [P8 [P [P [P [P [P+ \Y \P \P \P8 \P \P \P \P \Pc ]Y ]P ]P ]P ]P ]P ]P ]P ]P ^Y ^P ^P ^P ^P ^P ^P ^P ^Pi _Y _P _P _P _P _P _P _P _PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~` a b c d e f g h i j k l m n o p q r s t u v w x y z { | } ~   `Y `P `P `P `P `P `P `P `P~ aY aP aP aP aP aP aP aP aP bY bP bP bP bP bP bP bP bPi cY cP cP cP cP cP cP cP cP dY dP dP dP dP dP dP dP dPi eY eP eP eP eP eP eP eP ePO fY fP fP fP fP fP fP fP fPF gY gP gP gP gP gPq gP gP gPO hY hP hP hP hP hP hP hP hPF iY iP iP iP iP iPy iP iP iPO jY jP jP jP jP jP jP jP jPc kY kP kP kP kP kP kP kP kP+ lY lP lP lP lP lP lP lP lP mY mP mP mP mP mP  mP  mP mP nY  nP  nP  nP nP nP  nP nP nP oY oP oP oP oP oP oP oP oP pY pP pP pP pP pP pP pP pP+ qY qP qP qP qP qP qP qP qP rY  rP! rP" rP# rP$ rP% rP rP rP sY& sP' sP( sP} sPe sP) sP sP sPc tY* tP' tP+ tP} tP, tP- tP. tP tP uY/ uP' uP0 uP} uP1 uPE uP uP uPF vY2 vP' vP0 vP} vP3 vP4 vP vP vPF wY5 wP6 wP7 wP wP8 wP9 wP: wP wP xY; xP< xP= xP# xP> xP? xP xP xPF yY@ yPA yPB yPC yPD yPE yPF yP yP zYG zPH zPI zPJ zPK zPI zP zP zP8 {YL {PM {PN {PO {PP {PQ {PR {P {P |YS |PT |PU |PV |PW |PX |P |P |P~ }YY }PZ }P[ }P? }P }P\ }P }P }P ~Y] ~PZ ~P^ ~P? ~P_ ~P` ~P ~P ~P Ya Pb Pc Pd Pl Pe Pf P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~            v                     Yg Ph Pi P8 Pj Pk P P P Yl Pm Pn Po Pp Pn Pq P P Yr Pm Pn Ps Pt Pn Pq P P Yu Pm Pn Pv Pw Pn Pq P P Yx Py Pn Po Pz Pn P{ P P Y| P} PU P# P~ P P P P Y P} P P# P P P P P Y P P P P PT P P PU Y P P P P P P P Pc Y P P P P P P P P Y P P P P P P P Pc Y P P P P P P P P+ Y P P P P P P P PU Y P P P P P P P P Y P P P P Pq P P PO Y P P P P Pb P P P Y P P P P P P P P Y P P P P P P P Pc Y P P P P P P P P Y P P P P P P P P Y P P P P P P P Pc Y P P P P Py P P PO Y P P^ P P P P P P+ Y P P P P P P P P Y P P P P P P P PO Y P P P8 P P P P P Y P P P P P P P P Y P P P P P P P Pc Y P P P P P P P P Y P P P8 P P P P P+ Y P P P P P P P PU Y P P P8 P P P P PFD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~             v                    Y P P P P P P P Pc Y P P P P P P P P Y P P P8~ PHA P P P P Y P  P  P  P  P  P P PF Y P  P P P P P P P+ Y P  P P P P P P P Y P P P~ P P P P P Y P P P8 P  P P P PF Y! P" P P8 P# P P$ P P Y% P& PI P' P( PI P P P8 Y) P* P+ P8 P, P- P P P Y. P/ P P0 P# P P1 P P Y2 P3 P P4 P5 P P6 P P Y7 P8 P9 P: P; P< P P P Y= P> P? P@ PA PB PC P Pc YD PE P P8 PF PG P P P YH PE PI P8 PJ PK P P P YL PM PN PO PP PQ PR P P YS PT PU PV PW PX PY P P8 YZ P[ P\ P] P^ P_ P P P+ Y` Pa Pb Pc Pd Pe Pf P P Yg Pa Ph Pc Pi Pj P P P~ Yk Pa Pl Pc Pm Pn P P P8 Yo Pa Pl Pc Pp Pq P P PF Yr Pa Pl Pc Ps Pt P P PF Yu Pv Pw Px Py Pz P P P Y{ Pv P| P} P} P~ P P P+ Y Pv P P} P P P P P Y Pv P5 P} P P5 P P P8 Y Pv P P} P P P P PF Y P P P? P P P P P Y P P P P P P P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~   v          v                 H   Y P P P P P P P P~ Y P P P P P P P PU Y P P P8 P P P P P~ Y P P P8 P P P P P+ Y P P P P P P P PU Y P P P8 P  P P P PF Y P P P P Pn P P P8 Y P P P P P P P P Y P P P P P P P P+ Y P P P8 P P P P P Y P P P8~ P4A P P P P Y P P P P P P P P Y P P P~ PV P P P P Y P P P P P P P P Y P P P P PX P P P8 Y P P P P P P P PU Y P P  P P P  P P P Y P P  P P P  P P P Y P P P P PX P P P8 Y P P| P~ PpA P P P P Y P P P P P P P P+ Y P P P P Pn P P P8 Y P P P P P P P Pi Y P P P P P P P P Y P P^ P P P P P P+ Y P P P P P P P Pc Y P P P PW P P P P~ Y P P5 P P P5 P P P8 Y P P P P P: P P Pc Y P P  P  P  P P  P P Y  P P P P P P P P Y P P P P Pm P P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~                                 Y P P P P P P P P Y  P! P" P# P$ P% P& P P Y' P( P) P* P P+ P, P P Y- P. P/ P0 P1 P/ P P P2 Y3 P4 P5 P P6 P7 P P P Y8 P4 P5 P P9 P: P P P Y; P4 P5 P P9 P< P P P Y= P4 P> P P? PX P P P8 Y@ P4 PA P PB PC P P P YD P4 PA P# P PE P P P YF P4 PA P PG PH P P PU YI PJ P PK PL P PM P Pi YN PO PP P PQ PX P P P8 YR PO P P PS PT P P P YU PO P P PS PV P P P YW PO P P PX P~ P P P+ YY PO PZ P~ P8A P P P P Y[ PO PZ P P\ Pe P] P P Y^ P_ P  P P` Pa P P P Yb Pc P Pd Pe P P P Pi Yf Pg Ph Pi Pj Pk Pl P P Ym Pg Pn Po Px Pp Pl P PF Yq Pg Pn Pi Pr Ps Pt P P~ Yu Pv Pw PO Px Py Pz P P Y{ P| P} P? P~ P P P P Y P| P} P8 P P P P P Y P P P P P P P Pc Y P P P P Pn P P P8 Y P P P P Pk P P P Y P P Pd P Pk P P P Y P P P P P P P PU Y P P P P P P P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ v     H  H            v  v  v              Y P P P P^ P% P P P Y P P P P P P P P+ Y P P P P P P P Pi Y P P Pd Pj Pn P P P8 Y P P Pd P P P P P Y P P P P P P P Pi Y P P P8 P P P P Pi Y P P P P P P P Pi Y P P P8 P P P P P Y P P P8 PP P P P P Y P Ps P? P P P P P Y P Ps P? P P P P Pc Y P P P P P P P Pc Y P P P8 P P P P Pi Y P P P* P P P P P Y P P P P P P P P Y P P P P P P P PU Y P P P P P P P P Y P P P P P P P PF Y P P P P P P P PO Y P P P8 P P P P P+ Y P P P8 P P P P P Y P P P8 P P P P P Y P P P8 P P P  P PO Y  P P P? P  P P  P P Y  P P P8 P Pm P  P P Y P P P8 P P P  P P+ Y P P P8 P P P  P P Y P P P8 P P P  P Pc Y P P P8 P P P P PU Y P P P8 P Pf P P PU Y P P P? P* P P  P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~  ! " # $ % & ' ( ) * + , - v. v/ H0 1 2 3 4 5 v6 v7 8 9 : ; v< = > ?  Y P P P8 PP P  P  P P !Y! !P !P !P8 !P !P" !P  !P !P "Y# "P "P "P8 "P "P$ "P "P "PU #Y% #P #P& #P? #P' #P( #P  #P #P $Y) $P $P& $P? $P $P* $P  $P $P %Y+ %P %P& %P8 %P %P, %P  %P %Pi &Y- &P &P. &P? &P  &P/ &P  &P &P 'Y0 'P 'P1 'P8 'P2 'P3 'P  'P 'P (Y4 (P (P (P8 (P5 (P6 (P (P (P )Y7 )P )P8 )P9 )P: )P; )P  )P )P *Y< *P= *P? *P>~ *PA *P? *P *P *P? +Y@ +PA +P +PB +P +PC +PD +P +PU ,YE ,PA ,P ,P ,PP ,PF ,PG ,P ,P -YH -PA -PF -PI -PJ -PK -PL -P -P .YM .PA .PN .PO .PP .PN .PQ .P .P~ /YR /PA /PS /PT /P /PU /PV /P /P 0YW 0PA 0PX 0P? 0PY 0PZ 0PD 0P 0P 1Y[ 1PA 1PX 1P? 1P\ 1P] 1PD 1P 1P 2Y^ 2PA 2PX 2P? 2PY 2PE 2PD 2P 2P 3Y_ 3PA 3P` 3PI 3Pa 3Pb 3PD 3P 3PU 4Yc 4PA 4Pd 4Pe 4P  4Pf 4PD 4P 4P 5Yg 5PA 5Ph 5Pi 5Pj 5Pk 5Pl 5P 5P 6Ym 6PA 6Pn 6Po 6Pp 6Pq 6Pl 6P 6P 7Yr 7PA 7Ps 7Pi 7Pt 7Pu 7PD 7P 7PU 8Yv 8Pw 8Px 8Py 8Pz 8P{ 8P 8P 8P+ 9Y| 9P} 9P~ 9P? 9P 9P 9P 9P 9P :Y :P :P :P :P :P :P :P :Pi ;Y ;P ;PP ;P ;P ;P ;P ;P ;P <Y <P <P <P8 <P <P <P <P <P =Y =P =P =P? =P, =P =P =P =P >Y >P >P >P8 >P >P >P >P >P+ ?Y ?P ?P ?P8 ?P ?P ?P ?P ?POD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~@ A B C HD E F G H vI J K L M N O P Q R S T U V W X Y Z [ \ ] ^ _  @Y @P @P @P @P @P @P @P @P AY AP AP AP AP AP AP AP AP BY BP BP BP BP BP BP BP BPc CY CP CP CP CP CP CP CP CP DY DP DP DP DP DP DP DP DP+ EY EP EP EP EP; EPX EP EP EPc FY FP FP FP? FP FP FP FP FP GY GP GP GP~ GPC GP GP GP GP HY HP HP HP HP HP HP HP HPc IY IP IP IP IP IP IP IP IP JY JP JP JP JP JP JP JP JP KY KP KP KP8 KP KP KP KP KP8 LY LP LP LP8 LP LP LP LP LP MY MP MP MP8 MP MP MP MP MP NY NP NP NP8 NP NP NP NP NP OY OP OP OP OP OPT OP OP OPU PY PP PP PP PP PP PP PP PP+ QY QP QP QP QP QP QP QP QP+ RY RP RP RP RP RP RP RP RPO SY SP SP SP~ SP&5 SP SP SP SP TY TP TP TP TP TP TP TP TPc UY UP UP UP UP UP UP UP UPc VY VP VP VP8 VP5 VP VP VP VPi WY WP WP WP WP WP WP WP WPO XY XP XP XP XP XP XP XP XP8 YY YP YP YP YP YP YP YP YP ZY ZP ZP ZP ZP ZP ZP ZP ZP [Y [P [P [P [P [P [P [P [P+ \Y \P \P \P \P \P \P \P \PO ]Y ]P ]P ]P ]P ]Pq ]P ]P ]PO ^Y ^P ^P ^P ^P ^P ^P ^P ^P _Y  _P _P _P _P _P _P _P _PcD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~` a b c d e f g h i j k l m n o p q r s t u v w x y z { | } ~   `Y  `P  `P  `P8 `P  `P `P `P `P aY aP  aP  aP8 aP  aP  aP aP aP bY bP bP bP bP bP bP bP bP cY cP cP cP8 cP cP cP cP cP+ dY dP dP dP? dP dP dP  dP dP eY! eP eP eP8 eP" eP# eP$ eP ePi fY% fP& fP' fP8 fP fP( fP) fP fP gY* gP+ gP gP? gP, gP- gP gP gP+ hY. hP+ hP hP? hP/ hP hP0 hP hP iY1 iP2 iP^ iP8 iP3 iP4 iP5 iP iPF jY6 jP7 jP8 jP9 jP: jP; jP< jP jPU kY= kP> kP? kP@ kPA kPB kPC kP kP lYD lPE lPF lP8 lPF lPG lPH lP lPF mYI mPE mPF mP* mPJ mPK mP mP mP nYL nPM nPN nP8 nP nP nPO nP nP oYP oPQ oPR oPS oP oPT oP oP oP+ pYU pPV pPW pPX pP pPy pPY pP pP qYZ qP[ qP\ qP] qP^ qP_ qP qP qP rY` rPa rPS rPd rPb rPc rP rP rP sYd sPa sPS sPd sP sP" sP sP sP tYe tPf tP tPg~ tPjR tPh tPi tP tP uYj uPk uPl uP8 uPm uPH uP uP uP vYn vPo vP  vPp vPq vPr vPs vP vPc wYt wPo wP  wPp wPu wP wPs wP wPc xYv xPw xP xPx xPy xPz xP{ xP xP yY| yPw yP yP8 yP} yP~ yP yP yP~ zY zPw zP zP zP zP zP zP zP+ {Y {Pw {P' {P8 {PW {P {P {P {P |Y |Pw |P |P |P |P |P |P |P }Y }P }P }P }P }P }P }P }Pc ~Y ~P ~P  ~P? ~P ~P ~P ~P ~P Y P P  P8 P P P P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~          v       v v   v            Y P P  P? P P? P P PF Y P P$ P? Px P P P P Y P P P P P P P P Y P P P~ Pn P P P P Y P P P P P P P P Y P P P P P P P P Y P P P P PF P P P Y P P P8 P P P P P Y P P P8 P P P P P Y P P P8 P' P P P PU Y P P P8 P P P P P Y P PF P8 P P P P P Y P P P P P P P P Y P P P P P P P PU Y P P P P P P P P Y P P P8 P P P P P Y P P P8 P* P P P PU Y P P P8 P P P P PU Y P PB P P P P P P Y P PB P P PG P P P Y P P\ P~ PA P P P P Y P P/ P P P P P P+ Y P P P P P P P P Y P P P P P P P PU Y P PF P P P P P P Y P P P P P P P PO Y P P P P P P P PO Y P P P P P P P P Y P P P P P P P P Y P PN P P P P  P P8 Y P P P P P P P P Y P P P P P P P PUD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~       v v                         Y P P P P P P P Pi Y  P P P P  P P P Pi Y  P  P  P P P Pl P P Y P P P P P P P P Y P Po P P P P P P Y P P^ P P P P  P P Y! P" P# P$ P P% P& P Pc Y' P( P P) P* P P+ P P Y, P- P. P/ P0 P1 P2 P P Y3 P4 P5 P6 P7 P) P P P+ Y8 P4 P9 P6 P: P; P P P+ Y< P= P0 P# P> Pc P? P P Y@ P= P0 P# PA PX PB P P~ YC P= PD P# PE P PF P P+ YG PH PI PJ PK PL P P P~ YM PN P P PO P PP P P YQ PR P P~ PA P P P P? YS PT P P~ Pn P P P P? YU PV P P~ PA P P P P? YW PX PY PZ P[ P\ P P P Y] PX P PZ P^ P_ P P P Y` PX P PZ Pa P Pb P P Yc Pd Pe P Pf P Pg P PO Yh Pd Pe P P Pi Pj P P+ Yk Pd Pe Pl P Pm Pn P P Yo Pd Pp Pq Pr Ps P P P Yt Pd PZ P P Pu Pn P Pv Yw Px P P8 Py P P P P+ Yz P{ P P8 P| P} P~ P P Y P P P P P P P P Y P P P8 P P P P P+ Y P P P8 P P$ P P PUD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~                      v           Y P P P P P P P P+ Y P P P8 P Pm P P P Y P P P~ PP P P P P Y P PU P P P P P PO Y P PU P P P P P P+ Y P PU P P P] P P PF Y P P P P Py P P PO Y P P  P P P P P P Y P P P P P P P Pi Y P P P~ P@ P P P P Y P P P~ P@ P P P P Y P P P P P P P P Y P P P P P P P PU Y P P P P P P P P Y P Pc P P P P P P Y P P P P P\ P P P Y P Pb P P P P P PU Y P P P8 P P P P P Y P P P8 P P  P P P Y P P P P P P P P+ Y P P P P P P P P Y P P P P P P P P Y P P P P P` P P P Y P P P Py P P P P Y P PN P P PN P P P~ Y P P P P PK P P P Y P P P P P P P P+ Y P P P P: P P P P Y P P P8 P P\ P P P Y P P P8 P P P P Pc Y P P P P P P P P Y P P P8 P P P P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~       H v   v v v H H    v v v            Y P P P8 P Ps P P P Y P P P8 P P P P P Y P P P#~ PhA P P P P? Y P P P~ PpA P P P P? Y P P P Px P- P) P P Y  P P P P  P P) P P Y  P  P  P P P P P P8 Y P  P  P P[ P P P P Y P  P  P P P P P P Y P  P  P P P P P Pc Y P  P P P P  P P P Y P  P P P P P P P Y  P  P P P P! P P P Y" P  P P P# P$ P% P P Y& P  P P P' P P% P P Y( P  P P) P* P+ P P Pc Y, P  P- P8 P P. P/ P P Y0 P  P- P8 P1 P P P Pc Y2 P  P3 P8 Pm P4 P P P Y5 P  P3 P8 P6 P7 P P P Y8 P  P9 P: P; P< P P P Y= P  P P P P* P/ P P Y> P? P@ P P PA P  P P YB P? P@ P P PQ PC P P YD PE P P PF PG PH P Pv YI PJ PK P PL PM PN P P YO PP PQ P PR Pt P  P PF YS PT P P8 P  P P P Pi YU PV PW PS PX PY PZ P P Y[ P\ P] P P^ P_ P` P P Ya P\ P P Pb Pc Pd P P Ye P\ Pn P Pf P Pg P P8D@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~                                      Yh Pi Pj Pk~ P P P P P Yl Pm P PS P Pk P P P Yn Pm P Pk Po P Pp P P Yq Pm Pr Ps~ PA P P P P Yt Pu Pv P Pw P Px P P+ Yy Pz P P{ P| Pq Px P P Y} P~ P P Pj P P P PO Y P~ P P Pw P P P P Y P~ P P P P P P P+ Y P~ P P P' P P P P Y P~ P P P P P P P Y P~ P P P P P P P Y P~ P P P P P P P Y P~ P P P Pu P P Pv Y P P P P P P P Pi Y P P P8 P# P P P Pi Y P P P P^ P P P P+ Y P P' P8 P PA P P P Y P P' P8 P  P P P P Y P P P? P P P P P Y P P P P P] P P PF Y P P Pi P P P P P Y P PU P P P P P P Y P P P P P P P PO Y P P P P P P P P+ Y P P P P P P P P Y P P P} P PX P P P8 Y P P P P P P P P+ Y P P P P  P P P P Y P P P P P P P P Y P P P P P P P P Y P P P P P P P PcD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~  ! " # $ % v& ' ( ) * + , - v. / 0 1 2 3 4 5 6 7 8 9 : ; H< H= v> ? v Y P P P P P P P P+ !Y !P !P !P !P !P !P !P !Pc "Y "P "P "P "P "P "P "P "P8 #Y #P #P #P #P #P #P #P #P+ $Y $P $P $P $P $P $P $P $Pc %Y %P %P %P %P %P %P %P %Pc &Y &P &PX &P &P &P &P &P &P~ 'Y 'P 'P 'P 'P 'P 'PC 'P 'P~ (Y (P (P (P (P (P (P (P (P )Y )P )P )P )P )P )P )P )P *Y *P *P *P *P *P *P *P *Pc +Y +P +P +P +P +P +P +P +P8 ,Y ,P ,P ,P ,P ,P ,P ,P ,P -Y -P -P -P -P -P -P -P -P .Y .P .P .P .P .P .P .P .P /Y /P /P /P /P /P /P /P /P~ 0Y! 0P" 0P 0P 0P# 0Pa 0P 0P 0P 1Y$ 1P" 1PK 1P 1P% 1P 1P 1P 1P 2Y& 2P" 2P' 2P 2P 2P( 2Pb 2P 2P 3Y) 3P* 3P+ 3P, 3P- 3P+ 3P. 3P 3P8 4Y/ 4P0 4P1 4PS 4P1 4P2 4P 4P 4P+ 5Y3 5P4 5P 5P5 5P 5Pn 5P6 5P 5P8 6Y7 6P4 6P 6P8 6P9 6P: 6P; 6P 6P 7Y< 7P= 7P/ 7P8 7PW 7P> 7Px 7P 7P 8Y? 8P= 8P 8P8 8P@ 8P 8Px 8P 8P 9YA 9P= 9P 9P8 9P@ 9PB 9Px 9P 9P :YC :P= :PD :PO :P :PE :Px :P :P ;YF ;PG ;P  ;PH ;PI ;P ;PJ ;P ;P <YK <PG <P  <PH <PL <P <PJ <P <P =YM =PN =P =PO =P  =PP =P =P =Pc >YQ >PN >PN >P8 >PR >PM >PS >P >PO ?YT ?PN ?PN ?PU ?P^ ?PV ?P ?P ?PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~@ vA vB vC vD vE uF uG vH I J vK L M N O P Q R S T U V W X Y Z [ \ ] ^ _  @YW @PN @P @PO @PX @P% @P @P @Pc AYY APN APZ APU AP AP[ AP AP AP BY\ BP] BP BP^ BP_ BP BP BP BP CY` CP] CP CP^ CP CPe CP CP CP DYa DP] DPb DP^ DP DPQ DP DP DP EYc EPd EPe EP EPf EP EPg EP EP FYh FPd FPe FP FPi FPj FPg FP FP GYk GPl GP GPm ~ GPA GPn GPo GP GP HYp HPl HP HPq HPr HPs HP HP HP IYt IPu IP IPv IP IPX IP IP IP8 JYw JPx JPy JP8 JPz JP JP{ JP JP KY| KP} KP KP~ KP KP KP KP KP~ LY LP LP LP LP LP LP LP LP MY MP MP MP MP MP: MP MP MP NY NP NP NP NP NP NP NP NP OY OP OP OP OP* OP OP OP OP PY PP PP PP PP PP PP PP PP QY QP QPk QP QP QP QP QP QPi RY RP RP RP RPw RP RP RP RP+ SY SP SP SP# SP SP SP SP SP TY TP TP TP# TP TP TP TP TPU UY UP UP UP UP UPX UP UP UP8 VY VP VP VP VP VP VP VP VP WY WP WP WP WP WP WP WP WPU XY XP XPh XP XP XP XP XP XP YY YP YP YP9 YP YP YP YP YPc ZY ZP ZP ZP ZP ZPY ZP ZP ZP [Y [P [P [P8 [P [P [P [P [P8 \Y \P \P \P \P \P \P \P \P ]Y ]P ]P ]P# ]P ]P ]P ]P ]PU ^Y ^P ^P ^P ^P5 ^P ^P ^P ^P _Y _P _P _P _P _P _P _P _PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~` a b c d e f g h i j k l m n o p q r s t u v w x y vz { | } ~   `Y `P `P `P `P `P `P `P `P aY aP aP aP aP aP aP aP aP bY bP bPb bP bP bP bP bP bPF cY cP cP cP cP cP cP cP cP dY dP dP^ dP dPF dP. dP dP dPF eY eP ePw eP eP eP eP eP ePF fY fP fP fP fP fP fP fP fP gY gP gP5 gPd gP gP gP gP gP hY hP hP hP hP hP hP hP hP iY iP iP iP iP iP iP iP iP jY jP jP jP jP jP jP jP jP kY kP kPv kP kP: kP kP kP kP lY lP lP lPp lP lP lP lP lP mY mP mP mP mP mP mP mP mP nY nP nP nP8 nP_ nP nP nP nP oY oP oP oP oP oP oP oP oP pY pP pP pP pP pP! pP pP pP qY" qP qP qP qP# qP$ qP qP qP rY% rP& rP' rP rP( rP) rP rP rP sY* sP+ sP, sP- sP sP. sP sP sPF tY/ tP0 tP1 tP tP2 tP tP3 tP tP uY4 uP5 uP uP6 uP uP uP7 uP uP vY8 vP9 vP: vP6 vP; vP< vP= vP vP wY> wP? wPU wP8 wP wPq wP$ wP wP xY@ xP? xPA xP? xPB xPC xP$ xP xP yYD yP? yPA yPE yP9 yPF yPG yP yPc zYH zP? zPA zP8 zP9 zP zPG zP zPc {YI {P? {PA {P8 {PJ {PK {PL {P {P |YM |P? |PA |P8~ |PA |PN |PG |P |P? }YO }P? }PP }PQ }P }P1 }P$ }P }P ~YR ~P? ~PS ~PQ ~P ~P ~P$ ~P ~P YT PU Pp P PV Pp P P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~                             v    YW PX P PY PZ P[ P P P Y\ P] Pw P? P^ P P_ P PO Y` Pa Pb P8 P Pc P P P Yd Pe Pf Pg Ph Pi Pj P P Yk Pl P Pm P Pn P P P Yo Pl P Pm P P~ P P P~ Yp Pl Pe Pq P P P P P Yr Pl Ps Pt P Pu P P P Yv Pl Ps Pt Pw Px P P P Yy Pl Ps Pm P Pz P P P Y{ Pl P| Pq Pl P P} P P Y~ Pl P Pt P P P P P Y Pl P Pt P P: P P P Y Pl P Pq P P P P Pc Y Pl P  P P P  P P P Y Pl P Pm P P P} P PO Y Pl P P PP P P P P8 Y Pl P P P P P P P Y P P P8 P P P P Pi Y P P P P P P P P Y P P P8~ P@Q@ P P P P Y P P P P P P P P Y P P P P P P P P~ Y P PD P8 P P P P P Y P P P P P P P P+ Y P P P P P P P Pc Y P P P P P P P PU Y P P P PW P P P P Y P P Pd P# P P P P Y P PP P P P P P Pc Y P P P# P P P P Pi Y P P P P P P P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~        v v v v v v v v H                 Y P PU P P# P P P P Y P PU P P P P P P Y P P P P* P P P PU Y P P P P P P P Pi Y P P P P PG P P PF Y P P/ P P P/ P P P2 Y P P P8 P  P P P Pi Y P P P8 Pa P P P Pi Y P P P P Pn P P P8 Y P P P8 P P P P P8 Y P P P8 P P P P Pc Y P P P8 P P P P P Y P Pk P8 P P P P P Y P PQ P8 P Pt P P PF Y P P P8 P Pe P P P Y P P P P P P P P Y P P P P% P P P P Y P P P P P P P P Y P P P P P P P P Y P P P P P P P P Y P P P8 P P P P Pi Y P PH P P P5 P P P8 Y P Pe P P P P P P Y P PK P P P( P P P Y P P P P P< P P P Y! P Ps P P" PC P P P Y# P P$ P P PA P P PB Y% P P& P P' P P( P P Y) P* P P+ P, P P P P Y- P* P. P P/ P P P P Y0 P1 P2 P3 P4 P5 P P P Y6 P7 P8 P9 P* P: P P PcD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~             v  v                  Y; P< P= P> P? P P@ P PO YA P< P= P> PB PC PD P P YE P< P= P> PF Pj PG P P YH P< P= P PI P> PD P P YJ P< PK P PL PM PN P P YO PP P  PQ PR P$ P P PU YS PT PK PU P PV P P P YW PT PX P6 PY P` P P P YZ P[ P: P\ P] P^ P P P+ Y_ P` Pa P Pb P\ Pc P P Yd P` Pa P Pe Pf Pc P P Yg P` Pa P Ph P Pc P PU Yi P` Pj P Pk Pl Pm P P Yn P` Pb P Po PE Pp P P Yq P` Pr P PP P Ps P P Yt P` Pu P PP Pv Pw P P Yx Py Pz P~ PM P{ P| P P Y} Py Pz P~ P P P P Pc Y P P P P P P P P Y P Pn P P P P P P Y P P P PG P P P P+ Y P P P P P$ P P P Y P P P{ P P P P P+ Y P P P P* P9 P P P Y P P P P P P P P Y P P P8 P P P P Pi Y P P P P P P P Pc Y P P P Pw P P P P Y P P/ P P P/ P  P P2 Y P P  P P P P P P Y P P  P P( P" P P P Y P P  P P P  P P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~       v v           v              Y P PA P P P P P P+ Y P P P P P P P Pc Y P P P P P P P P Y P P P Pw P P P P Y P P8 P P P P  P P Y P P P P P P  P P8 Y P P Pd P* P P P P8 Y P P Pd P P P P P Y P P P8 P Pu P P PB Y P Po P P Pq P P PO Y P P P P PE P P PF Y P P P Pa P P P P Y P P P P P P P P Y P P P P PA P P PB Y P P P8 P P P  P P Y P P P8 P* P P P P Y P P P8 P P P P P8 Y P P P8 P P P P P8 Y P P P P P P P P Y P P P8 P P P P Pc Y P P P P P P P P~ Y P P P8 P P P P P Y P P P P P PM P P Y P P P P P PM P P Y P P P P P P P P Y P P P P_ P P P P Y P P Pk P P P P P Y P P PS Pj P P P P+ Y P P P8 PR P P P P Y P P P8 P Px P P P Y! P" P+ P# P$ P% P& P P Y' P( P P) P* P6 P P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~    v                     v v v    v v  v v v v Y+ P, P- P P. Pi P P P Y/ P0 P P P1 P P2 P P Y3 P4 P P? P5 P P P P Y6 P4 P P7 P8 P9 P: P P Y; P4 P P? P< P= P P P Y> P4 P P? P? P P P P+ Y@ PA PB PC PD P P P PU YE PF P# P8 PL PG PH P P YI PF P PJ P^ PK P P P YL PF PM PN P P` P P P YO PF PM P8 P Pk PH P P YP PQ PR Pd PS P PT P Pc YU PV PW PX PY P PZ P P Y[ P\ P] P^ P P P_ P P Y` Pa Pb P P P P P P Yc Pd P Pe Pf P Pg P PU Yh Pi P Pj P1 P P P Pi Yk Pl Pm Pn Po P Pp P P Yq Pr P Ps P P Pt P Pc Yu Pv Pw Px P P- P P P+ Yy Pz P P P P P{ P P8 Y| Pz P P P P} P{ P Pc Y~ Pz P P8 P P P P P Y Pz P P8 PL P P P P+ Y Pz P& P8 P P P P P~ Y Pz P P8 P P P{ P PF Y Pz P P P P P P P Y Pz P P P PC P P PU Y Pz P P P P P P P Y Pz P P P P P P P Y Pz P P P8 P P{ P Pc Y Pz P P P P P{ P PcD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~  v! " v# v$ v% v& v' ( ) * + , - . / 0 1 2 3 4 5 6 7 8 9 : ; < = > ?  Y Pz P- P8 PW Pu P P Pv !Y !Pz !P !P~ !P !P !P !P !P "Y "Pz "P "P8 "P "P "P "P "P #Y #Pz #P #P #P #P #P{ #P #P $Y $Pz $P, $P? $P $P $P{ $P $PF %Y %Pz %P, %P? %P %P %P{ %P %PF &Y &Pz &P &P? &P &P &P{ &P &Pc 'Y 'P 'P 'P 'P 'P 'P 'P 'Pi (Y (P (P (P8 (P (P (P (P (P8 )Y )P )P )P )P )P )P )P )P *Y *P *P *P8 *P1 *P *P *P *Pi +Y +P +P +P +P +P +P +P +P ,Y ,P ,P ,P8 ,P ,P ,P ,P ,P -Y -P -P -P8 -P -P -P -P -P .Y .P .P .P8~ .PhA .P .P .P .P /Y /P /P /P /P /P /P /P /P 0Y 0P 0P 0P8 0P 0P 0P 0P 0P+ 1Y 1P 1P 1P8 1P 1P 1P) 1P 1P 2Y 2P 2P 2P 2P 2P 2P 2P 2Pi 3Y 3P 3P 3P 3P 3P 3P 3P 3P 4Y 4P 4P 4P 4P 4P 4P  4P 4Pi 5Y 5P 5P 5P 5P 5P 5P 5P 5Pi 6Y 6P 6P 6P 6P 6P 6P 6P 6P+ 7Y 7P 7P 7P 7P* 7P 7P  7P 7P 8Y 8P 8P 8P 8PP 8P 8P 8P 8P 9Y 9P 9P 9P8 9P* 9P 9P 9P 9P+ :Y :P :P :PS :P :P :P :P :P+ ;Y ;P ;P ;P ;PW ;P ;P ;P ;P <Y <P <P <P <P <P <P <P <Pc =Y =P =P =P8 =P =Pc =P =P =P >Y >P >P >P >P >Pk >P >P >P ?Y ?P ?PN ?P ?P ?P ?P ?P ?P8D@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~@ A B C D E F G vH vI J K L M N O P Q R S T U V W X Y Z [ \ ] ^ _ v @Y @P @P @P @P @PM @P @P @P AY AP AP AP AP* AP AP AP AP BY BP BP BP8 BP* BP BP BP BP+ CY CP CPR CP CP CP! CP CP CP DY DP DP DP DP DP DP DP DP EY EP EP EP EP EP EP EP EPc FY FP FPU FP FP FP FP FP FP GY GP GP GP GP GP GP GP GP HY HP HP HP HP HP HP HP HP IY IP IP! IP" IP# IP$ IP% IP IP JY& JP' JP JP9 JP( JP JP) JP JPc KY* KP+ KP, KP KP KP KP- KP KP LY. LP+ LP/ LP LP0 LP LP1 LP LP MY2 MP+ MP3 MP4 MP MP5 MP6 MP MPc NY7 NP8 NP9 NP: NPw NP NP; NP NP OY< OP8 OP OP= OP> OP OP? OP OP PY@ PPA PP PPB PP  PP PP PP PPi QYC QPA QP^ QPD QP_ QP QPE QP QPO RYF RPG RP RPH RP RP RP RP RP SYI SPJ SPK SPL SP SP3 SP SP SP TYM TPN TP TP TPO TPP TP TP TP UYQ UPN UPR UPS UPT UPM UPU UP UPO VYV VPN VPW VP6 VPX VP VPU VP VPO WYY WPN WPZ WP WP WPu WP WP WPv XYZ XPN XPZ XP XP~ XP[ XP XP XPi YY\ YPN YP7 YP YP] YP YPU YP YPO ZY^ ZP_ ZP` ZPa ZPb ZPT ZP ZP ZP+ [Yc [Pd [Pe [P [Pf [P [Pg [P [P \Yh \Pi \P \P8 \P \P \P \P \P ]Yj ]Pi ]P ]P8 ]P ]P ]P ]P ]P ^Yk ^Pi ^P ^P8 ^P~ ^P_ ^P ^P ^P+ _Yl _Pm _Pn _P8 _P _P _Po _P _PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~` a b c vd e f g h vi vj k l m n o p q r s t u v w x y z { | } ~   `Yp `Pq `Pr `P `P `Ps `Px `P `P aYt aPq aPu aP aP aP aPx aP aP bYv bPw bPx bP8 bPy bP bP bP bP cYz cP{ cP| cP} cP~ cP cP cP cPc dY dP dP dP dP dP dP dP dP eY eP eP eP8 eP eP eP eP eP fY fP fP fP fP fP fP fP fP gY gP gP gP8 gP gP: gP gP gP hY hP hP hP hP hP hP hP hP iY iP iP iP iP iPf iP iP iP jY jP jP3 jP jP jP jPM jP jP kY kP kPH kP kP kP5 kP kP kP8 lY lP lPe lP lP lP lP lP lP mY mP mPe mP mP mP mP mP mP nY nP nPK nP nP nP_ nP nP nP oY oP oP oP oP oP+ oP oP oPF pY pP pP pP pP pP pP pP pP qY qP qP qP qP qP qP qP qP rY rP rP rP rP rP rP rP rP sY sP sP sP sP sP sP sP sP tY tP tP tP tP tPh tP tP tP uY uP uP? uP uP uP uP uP uP vY vP vP vP vP vP vP vP vPc wY wP wP wP wP wP wP wP wP xY xP xPH xP? xP xP5 xP xP xP8 yY yP yP yP yP yP yP yP yP zY zP zPU zP? zP zP zP zP zPU {Y {P {PK {P? {PP {P {P {P {PF |Y |P |P |P? |P |P |P |P |PO }Y }P }P3 }P? }P }P }P }P }PO ~Y ~P ~P ~P? ~P ~P ~P ~P ~PO Y P P P? P P P P POD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~               v v v v v v v            Y P Pm P? P Py P P PO Y P P P? P P P P P Y P P P P P; P P PU Y P P P P P P P P Y P P P8 P P P P PF Y P P P P P P P PF Y P P P P P P P P Y P P P Pe P P P P Y P P P P P P P P Y P P P P P P P PU Y P P^ P? P P P P PO Y P P^ P P P P P PF Y P P P P P P P P Y P P P  P  P P  P P Y  P  P P PL P" P P P Y P  P P P P P P P Y P  P P P P P P P Y P  P P P P P P P Y P  P P P P P P P Y P  P P P P P P PU Y P  P- P P P P P P Y P P: P8 P  Pu P! P P Y" P P: P? P# P P$ P P Y% P P: P8 P& P P$ P P+ Y' P P P8 P( P) P! P P Y* P+ P, P- P1 P P P P+ Y. P/ P0 P1 P2 P P3 P P~ Y4 P/ P0 P1 P5 P P6 P PO Y7 P/ P P1 P8 P9 P$ P P Y: P; Pe P P< P= P P P Y> P; Pe P P? P@ P P PF YA P; Pe P P5 P P P PcD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~                                 YB P; PU P~ PhA P P P P YC P; PU P P PD PE P P YF P; P P P P P P P YG P; P P P  P P P Pi YH P; P P PW P# P P Pi YI P; P P PJ PK P P PU YL PM P P P P P P P YN PM P  PO P; P  P P P YP PQ PR P} PS PT P P P YT PQ PR Px PU P< P P P YV PQ PR Px PW PX PE P P YY PQ PR Px PZ P PE P P Y[ PQ P Px~ P P P P P Y\ PQ P] Px P^ P P P PF Y_ PQ P] Px P` Pa P P PF Yb Pc Pd P P P P P Pc Ye Pf P5 P Pg P5 P P P8 Yh Pf Pe P P^ P P P P Yi Pf Pe P P Pj P P P Yk Pf Pe P P Pb P P PU Yl Pf P P Pm P P P P Yn Pf Po P Pp Pz P P P Yq Pf P Pq Pj P9 Pr P P Ys Pt Pu Pv Pw P P P PF Yx Pt Py Pz P{ P4 P P PU Y| Pt P} P~~ P[ P P P P Y Pt P Pz P P P P P Y P Pe P> P6 P P P PF Y P Pe P> P P P P Pi Y P P P P PK P P PU Y P P P P P P P PO Y P P P P P P P P8D@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~                                 Y P P P  P P P P Pi Y P P P P PX P P P8 Y P P1 P  P P P P P Y P Pb P P P P P PF Y P P P P PD P P P Y P P P# P P P P P Y P P P# P: P P P P Y P P P P P P P Pc Y P PB P P P$ P P P Y P P P P P P P P~ Y P P P P P P P P Y P P P8 P* P P P P+ Y P Pe P P PM P P PO Y P P^ P PF P P P PO Y P P P P P P P PO Y P Pe P P P+ P P P Y P P P P P P P Pi Y P P P8~ P=@ P P P P Y P P P P P P P PF Y P P P~ PA P P P P Y P P P P P P P PU Y P P P P P P P P Y P P P P P P P P Y P P P P P P P P+ Y P P P P P P P PU Y P P P P P P P PF Y P P Pd P P P P P Y P P P P P P P P Y P PB P P Pq P P PF Y P P P P* P P P Pc Y P P P P P P P P Y P P P P P P P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~                             v v   Y P P8 P P P P P P Y P PN P P PN P P P~ Y P P P P P! P P P Y P P P Pa P P P P+ Y P P P P P P P Pi Y P P P P5 P P P P8 Y  P  P  P Pw Pl P  P P Y  P P P P P P P Pc Y P Ps P P P P P PU Y P P P P P P P P Y P PU P P P/ P P P Y P PU P P P P P P Y P PU P P* P P P P Y P P P P  P P P P Y! P" P# P$ P% P P& P P Y' P( P) P P* P P+ P PO Y, P( P P P- P P P P Y. P( P/ P P0 P1 P P P Y2 P( P/ P P3 P; P P PU Y4 P( P5 P P6 P P P P Y7 P( P8 P P  P P P P8 Y9 P( P8 P P P: P P PU Y; P( P8 P P< P P P Pc Y= P( P> P P? P P P PU Y@ P( P P PA Pq P+ P PO YB P( Pu P PC P P P P+ YD P( Pu P PE PF P P Pi YG P( Pu P P PB P P Pc YH PI PJ PK PL PA PM P PU YN PI PO PP Pi PQ PM P PF YR PI PO P8 PS P% P P P YT PI P P8 P* P P P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~  v v v v v v v   v    v     v u v          v    H  YU PI P PV P PW PX P P YY PI P PK P PZ P[ P Pi Y\ PI P] P^ P P_ P P Pi Y` PI Pa PK Pb Pc Pd P Pi Ye PI Pa PK Pf Pg Ph P Pi Yi PI P PK P P PM P PU Yj PI Pk Pl Pm P_ Pn P P Yo PI Pp Pq Pr P Ps P P8 Yt PI Pu PV PP P1 PX P P Yv PI P Pq P P Ps P P8 Yw PI Px Py Pz P: P{ P Pc Y| PI P} P~~ PV t Ph P P P Y P P Pp P P P P P~ Y P P P P P P P P8 Y P P P P P P P P Y P PN P} P P P P P2 Y P P P P P P P P Y P P@ P P P P P P Y P P@ P P P P P P Y P P) P P P P P PO Y P P) P~ Pin P P P P Y P P) P P P P P Pc Y P P Pp P P P P P~ Y P P- Pk P P P P P+ Y P P P P P P P P+ Y P P P P P P P Pi Y P P P8 P P P P P Y P P Pd P Pc P P P Y P P P P P{ P P P+ Y P P P P P P P Pi Y P P P P P P P P Y P P P P P P P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~  ! " # $ % & ' ( ) * + , - . / 0 1 2 3 4 5 6 7 8 9 : ; < = > ?  Y P P P P P P P P !Y !P !P !P !P !P !P !P !Pc "Y "P "P "P "P "P "P "P "P #Y #P #P #P #P #P #P #P #P $Y $P $P $P $P $P $P $P $P+ %Y %P %P %P %P %P %P %P %PF &Y &P &P &P &P &P &P &P &PO 'Y 'P 'P 'P 'P 'P 'P 'P 'P (Y (P (P (P (P (P (P (P (P )Y )P )P )P )P )P )P )P )PU *Y *P *P *P *P *Pc *P *P *P +Y +P +P +P +P +Pq +P +P +PO ,Y ,P ,P ,P ,P^ ,P ,P ,P ,PU -Y -P -P -P -PX -P -P -P -P .Y .P .P# .P .P .PV .P  .P .P /Y /P /P /P /P /P; /P  /P /P 0Y  0P  0P  0P 0P  0P 0P 0P 0P 1Y 1P 1P 1P 1P 1Pq 1P 1P 1PO 2Y 2P 2P 2P- 2P 2PP 2P 2P 2Pc 3Y 3P 3Ph 3P 3P 3P 3P 3P 3P 4Y 4P 4P 4PZ 4PW 4P+ 4P 4P 4PF 5Y  5P! 5P 5P" 5P# 5P 5P 5P 5Pi 6Y$ 6P% 6P& 6P? 6P' 6P( 6P 6P 6P 7Y) 7P% 7Pp 7P? 7P* 7Pp 7P+ 7P 7P 8Y, 8P- 8P. 8P? 8P/ 8P= 8P 8P 8P 9Y0 9P- 9P. 9P1 9P2 9P3 9P 9P 9P :Y4 :P5 :P :P :P6 :P$ :P7 :P :PU ;Y8 ;P9 ;P: ;P? ;P; ;P< ;P ;P ;P <Y= <P9 <P: <P? <P} <P( <P <P <P =Y> =P9 =P: =P? =P? =P@ =P =P =PU >YA >P9 >P: >P? >P} >P >P >P >P ?YB ?P9 ?P: ?P? ?P ?P ?P ?P ?PcD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~@ A B C D E F G H I J K L M N O P Q R S T U V W X Y Z [ \ ] ^ _  @YC @P9 @P: @P? @PD @PE @P @P @P AYF AP9 APp AP? APG APj AP AP AP BYH BP9 BPp BP? BPI BPp BP BP BP CYJ CP9 CPp CP CPK CPp CPL CP CP DYM DPN DPO DPP DP DP DP DP DP EYQ EPN EP EPR EP EPW EP EP EP FYS FPT FPU FPV FPW FPU FP FP FPU GYX GPY GP5 GPZ GP[ GP\ GP GP GPc HY] HPY HPH HP^ HP_ HP5 HP HP HP8 IY` IPY IPe IPQ IP IP IPa IP IP JYb JPY JP$ JPQ JP; JPe JPa JP JP KYc KPY KPd KPe KP_ KPP KP KP KP LYf LPg LP LPh LPi LP LP LP LP8 MYj MPk MP MP MPl MPm MPn MP MP NYo NPk NP NP NPX NP. NPn NP NP OYp OPk OP OP OPX OPb OPq OP OPc PYr PPs PP PP PPt PPM PPu PP PP QYv QPw QP QPx QP QP QPy QP QP RYz RP{ RPU RP| RP} RP~ RP RP RP SY SP SP SP SP SP SP SP SP TY TP TP TP TP TP TP TP TPO UY UP UP UP UP UPu UP UP UPv VY VP VP VP VP VP VP VP VP WY WP WPU WP WP WPM WP WP WPO XY XP XP XP XP XP XP XP XP YY YP YPU YP? YPW YP YP YP YP ZY ZP ZP^ ZP? ZP ZP` ZP ZP ZP [Y [P [P> [P [P\ [Pm [P [P [P \Y \P \P> \P \P \P \P \P \P ]Y ]P ]P> ]P ]PB ]PC ]P ]P ]P ^Y ^P ^P> ^P ^PB ^P ^P ^P ^P+ _Y _P _P> _P _P _P _P _P _PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~` a b c d e f g h i vj k l m n o p q r s t u v w x y z { | } ~   `Y `P `P> `P `P `P `P `P `P aY aP aP> aP aP aP aP aP aPU bY bP bP bP bP bP bP bP bP cY cP cPS cP cP cP cP cP cPi dY dP dP dP dP dPs dPl dP dP eY eP eP eP8 eP eP eP eP ePB fY fP fP fP8 fP fP fP fP fPB gY gP gP gPO gP gP gP gP gPi hY hP hP hP hP  hP hP hP hP8 iY iP iP iP~ iPhA iP iP iP iP jY jP jP jP jP  jP jP jP jP kY kP kP kP kP kP kP kP kPc lY lP lPN lP lP lPN lP lP lP~ mY mP mP mP mP mP mP mP mP nY nP nP nP nP nP nP nP nP oY oP oP oP oP oP oP oP oP~ pY pP pP^ pP pP pP pP pP pP+ qY qP qPK qP qP qP) qP qP qP rY rP rP[ rP rP rPM rP rP rPO sY sP sP sP sP sP sP sP sPi tY tP tP tP tP tPM tP tP tPO uY uP uP uP8~ uPHA uP uP uP uP vY vP vP vP~ vP< vP vP vP vPU wY wP wP wP~ wP* wP wP wP wP xY xP xPW xP xP xPp xP xP xPF yY yP yP yP yP yP yP yP yP2 zY zP zP zP zP zP zP zP zP2 {Y {P {P {P {P {P {P {P {Pc |Y |P |P |P |Pa |P |P |P |P }Y }P }P }P }P }P }P }P }P ~Y ~P  ~P ~P~ ~P  ~P ~P ~P ~Pi Y  P  P PO P P P P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~    v H H             v v   v          Y  P  P P~ P1 P[ P P Pi Y  P  P P P P P P P Y P PI P P PI P P P8 Y P P P P# P P P P Y P P P P@ Pj P P P Y P P P P~ P P P P Y P P P8 P P P P P+ Y P  P P P  P? P P PF Y! P  P P P" P# P P P Y$ P  P7 P P% P P P P+ Y& P  P' P P P( P P P Y) P* PU P P P P+ P P Y, P* PU P P* PD P+ P P Y- P. P/ P0 P1 P Pl P P Y2 P3 P P4 P5 P P6 P P Y7 P8 P P9 P P: P; P P Y< P= P> P8 P? P@ PA P P YB PC PD P P PE P P P YF PG PH P P* P PI P P8 YJ PG PK PL PM P PN P P YO PG P P8 P* P PP P P+ YQ PG PZ PR PS P PT P PU YU PG PI P P( PI PI P P8 YV PW PX PY PX PZ Pn P P+ Y[ P\ P] P P^ P_ P P P+ Y` P\ Pa P8 P\ Pb P P Pi Yc Pd P P? Pe Pn P P P8 Yf Pg Ph Po~ Pyn P P P P Yi Pg Ph Po Pj P P P P Yk Pg Ph Po Pl P P P P Ym Pg Ph Po Pn P P P Pc Yo Pp Pq P Pr P: Ps P PD@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~                                 Yt Pu P P PL P P  P Pi Yv Pu Pw Px P P P  P P+ Yy Pz P/ P P{ P P| P PU Y} P~ P P P P P P PU Y P P P8 P# P P P PF Y P P P P P P P P Y P P P8 P  P P P P+ Y P P P8~ PHA P P P P Y P P P Pj P P P P Y P P P P P P P Pc Y P P P P P P P P8 Y P PS P8 P Pj P P P Y P P P P Pn P P P8 Y P P P P P P P P8 Y P P P PP P P P P Y P P P P P^ P P P+ Y P P P P P P P P2 Y P P P P P P P P Y P P P~ P0A P P P P? Y P P P~ P@A P P P P? Y P P P P P P P P Y P P P P P P P P Y P P? P~ P4A P? P P P? Y P P? P~ P4A P? P P P? Y P P P P P^ P P P+ Y P P? P>~ PA P? P P P? Y P P P P P P P P2 Y P P P P PT P P PU Y P P P8 P P P~ P P Y P P P P P; P P P Y P P P8 P P P P P Y P P+ P P P+ P P P8D@l~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~                                 Y P Pp P P Pp P P P Y P Pp P P Pp P P PPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPDl~~             PPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPPp< P$(  L  3 ]F! d NTL  3 ]F! d NTL  3 ]F! d NTL  3 ]F! d NTL  3 ]F! d NTL P 3 ]F! d NTL P 3 ]F! d NTL P 3 ]F! d NTL P 3  ]F! d N>@d   ggD   %  dMbP?_*+%&?'?(?)?" dRQ?RQ?& U>@d ggD   %  dMbP?_*+%&?'?(?)?" dRQ?RQ?& U>@d ggD   W$hZ@@@@x`@|| Oh+'0   ,8@HPxC /:PYYY/:D1@&@ )KMicrosoft Excel՜.+,D՜.+,d    gddaDocumentSummaryInformation8 (\dlKSOProductBuildVer2052-10.8.0.6423